C25H26N4O5S — CID 20746080
N-(3-hydroxypropyl)-5-[2-(3-hydroxypyrrolidine-1-carbonyl)thieno[3,2-b]pyridin-7-yl]oxy-2-methylindole-1-carboxamide (PubChem CID 20746080) has the molecular formula C25H26N4O5S and a molecular weight of 494.57 g/mol. Its IUPAC name is N-(3-hydroxypropyl)-5-[2-(3-hydroxypyrrolidine-1-carbonyl)thieno[3,2-b]pyridin-7-yl]oxy-2-methylindole-1-carboxamide.
| Compound Name | N-(3-hydroxypropyl)-5-[2-(3-hydroxypyrrolidine-1-carbonyl)thieno[3,2-b]pyridin-7-yl]oxy-2-methylindole-1-carboxamide |
|---|---|
| PubChem CID | 20746080 |
| Molecular Formula | C25H26N4O5S |
| Molecular Weight | 494.57 g/mol |
| Exact Mass | 494.16 |
| IUPAC Name | N-(3-hydroxypropyl)-5-[2-(3-hydroxypyrrolidine-1-carbonyl)thieno[3,2-b]pyridin-7-yl]oxy-2-methylindole-1-carboxamide |
| SMILES | Cc1cc2cc(Oc3ccnc4cc(C(=O)N5CCC(O)C5)sc34)ccc2n1C(=O)NCCCO |
| InChI | InChI=1S/C25H26N4O5S/c1-15-11-16-12-18(3-4-20(16)29(15)25(33)27-7-2-10-30)34-21-5-8-26-19-13-22(35-23(19)21)24(32)28-9-6-17(31)14-28/h3-5,8,11-13,17,30-31H,2,6-7,9-10,14H2,1H3,(H,27,33) |
| InChIKey | FIMKURQDBBZBMI-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 116.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.57 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|