C16H34N10O5 — CID 20746149
1,3-dimethyl-1-[1,2,3,4-tetrakis(methylcarbamoylamino)pentyl]urea (PubChem CID 20746149) has the molecular formula C16H34N10O5 and a molecular weight of 446.51 g/mol. Its IUPAC name is 1,3-dimethyl-1-[1,2,3,4-tetrakis(methylcarbamoylamino)pentyl]urea.
| Compound Name | 1,3-dimethyl-1-[1,2,3,4-tetrakis(methylcarbamoylamino)pentyl]urea |
|---|---|
| PubChem CID | 20746149 |
| Molecular Formula | C16H34N10O5 |
| Molecular Weight | 446.51 g/mol |
| Exact Mass | 446.27 |
| IUPAC Name | 1,3-dimethyl-1-[1,2,3,4-tetrakis(methylcarbamoylamino)pentyl]urea |
| SMILES | CNC(=O)NC(C)C(NC(=O)NC)C(NC(=O)NC)C(NC(=O)NC)N(C)C(=O)NC |
| InChI | InChI=1S/C16H34N10O5/c1-8(22-12(27)17-2)9(23-13(28)18-3)10(24-14(29)19-4)11(25-15(30)20-5)26(7)16(31)21-6/h8-11H,1-7H3,(H,21,31)(H2,17,22,27)(H2,18,23,28)(H2,19,24,29)(H2,20,25,30) |
| InChIKey | VRNZIMQINJSVRY-UHFFFAOYSA-N |
| XLogP | -2.57 |
| TPSA | 196.86 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.51 |
| LogP ≤ 5 | -2.57 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|