C20H22F12O5 — CID 20746798
tert-butyl 4-[(3,4-difluoro-4-methyl-2,5-dioxooxolan-3-yl)methyl]-6,6,7,7-tetrafluoro-2-methyl-2,5-bis(trifluoromethyl)heptanoate (PubChem CID 20746798) has the molecular formula C20H22F12O5 and a molecular weight of 570.37 g/mol. Its IUPAC name is tert-butyl 4-[(3,4-difluoro-4-methyl-2,5-dioxooxolan-3-yl)methyl]-6,6,7,7-tetrafluoro-2-methyl-2,5-bis(trifluoromethyl)heptanoate.
| Compound Name | tert-butyl 4-[(3,4-difluoro-4-methyl-2,5-dioxooxolan-3-yl)methyl]-6,6,7,7-tetrafluoro-2-methyl-2,5-bis(trifluoromethyl)heptanoate |
|---|---|
| PubChem CID | 20746798 |
| Molecular Formula | C20H22F12O5 |
| Molecular Weight | 570.37 g/mol |
| Exact Mass | 570.13 |
| IUPAC Name | tert-butyl 4-[(3,4-difluoro-4-methyl-2,5-dioxooxolan-3-yl)methyl]-6,6,7,7-tetrafluoro-2-methyl-2,5-bis(trifluoromethyl)heptanoate |
| SMILES | CC(C)(C)OC(=O)C(C)(CC(CC1(F)C(=O)OC(=O)C1(C)F)C(C(F)(F)F)C(F)(F)C(F)F)C(F)(F)F |
| InChI | InChI=1S/C20H22F12O5/c1-14(2,3)37-11(33)15(4,20(30,31)32)6-8(9(19(27,28)29)18(25,26)10(21)22)7-17(24)13(35)36-12(34)16(17,5)23/h8-10H,6-7H2,1-5H3 |
| InChIKey | XTPWJUUTTJBVAK-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.37 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|