C10H14O5S — CID 20746803
3-methyl-4-(4-methyl-1,1-dioxothiolan-3-yl)oxolane-2,5-dione (PubChem CID 20746803) has the molecular formula C10H14O5S and a molecular weight of 246.28 g/mol. Its IUPAC name is 3-methyl-4-(4-methyl-1,1-dioxothiolan-3-yl)oxolane-2,5-dione.
| Compound Name | 3-methyl-4-(4-methyl-1,1-dioxothiolan-3-yl)oxolane-2,5-dione |
|---|---|
| PubChem CID | 20746803 |
| Molecular Formula | C10H14O5S |
| Molecular Weight | 246.28 g/mol |
| Exact Mass | 246.06 |
| IUPAC Name | 3-methyl-4-(4-methyl-1,1-dioxothiolan-3-yl)oxolane-2,5-dione |
| SMILES | CC1CS(=O)(=O)CC1C1C(=O)OC(=O)C1C |
| InChI | InChI=1S/C10H14O5S/c1-5-3-16(13,14)4-7(5)8-6(2)9(11)15-10(8)12/h5-8H,3-4H2,1-2H3 |
| InChIKey | CTZFQEJWOFWSSI-UHFFFAOYSA-N |
| XLogP | 0.00 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.28 |
| LogP ≤ 5 | 0.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|