C24H22ClN5O4S — CID 20747503
N-(5-chloro-2-pyridinyl)-2-[[4-(1,1-dioxo-1,4-thiazinane-4-carboximidoyl)benzoyl]amino]benzamide (PubChem CID 20747503) has the molecular formula C24H22ClN5O4S and a molecular weight of 511.99 g/mol. Its IUPAC name is N-(5-chloro-2-pyridinyl)-2-[[4-(1,1-dioxo-1,4-thiazinane-4-carboximidoyl)benzoyl]amino]benzamide.
| Compound Name | N-(5-chloro-2-pyridinyl)-2-[[4-(1,1-dioxo-1,4-thiazinane-4-carboximidoyl)benzoyl]amino]benzamide |
|---|---|
| PubChem CID | 20747503 |
| Molecular Formula | C24H22ClN5O4S |
| Molecular Weight | 511.99 g/mol |
| Exact Mass | 511.11 |
| IUPAC Name | N-(5-chloro-2-pyridinyl)-2-[[4-(1,1-dioxo-1,4-thiazinane-4-carboximidoyl)benzoyl]amino]benzamide |
| SMILES | [H]/N=C(\c1ccc(C(=O)Nc2ccccc2C(=O)Nc2ccc(Cl)cn2)cc1)N1CCS(=O)(=O)CC1 |
| InChI | InChI=1S/C24H22ClN5O4S/c25-18-9-10-21(27-15-18)29-24(32)19-3-1-2-4-20(19)28-23(31)17-7-5-16(6-8-17)22(26)30-11-13-35(33,34)14-12-30/h1-10,15,26H,11-14H2,(H,28,31)(H,27,29,32)/b26-22+ |
| InChIKey | JQWPVEAYMTUSRV-XTCLZLMSSA-N |
| XLogP | 3.30 |
| TPSA | 132.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.99 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|