C35H45N5O5S — CID 20747633
N-[5-[(2-butyl-4-oxo-1,3-diazaspiro[4.4]non-1-en-3-yl)methyl]-2-[2-[(3,4-dimethyl-1,2-oxazol-5-yl)sulfamoyl]phenyl]phenyl]-3,3-dimethylbutanamide (PubChem CID 20747633) has the molecular formula C35H45N5O5S and a molecular weight of 647.84 g/mol. Its IUPAC name is N-[5-[(2-butyl-4-oxo-1,3-diazaspiro[4.4]non-1-en-3-yl)methyl]-2-[2-[(3,4-dimethyl-1,2-oxazol-5-yl)sulfamoyl]phenyl]phenyl]-3,3-dimethylbutanamide.
| Compound Name | N-[5-[(2-butyl-4-oxo-1,3-diazaspiro[4.4]non-1-en-3-yl)methyl]-2-[2-[(3,4-dimethyl-1,2-oxazol-5-yl)sulfamoyl]phenyl]phenyl]-3,3-dimethylbutanamide |
|---|---|
| PubChem CID | 20747633 |
| Molecular Formula | C35H45N5O5S |
| Molecular Weight | 647.84 g/mol |
| Exact Mass | 647.31 |
| IUPAC Name | N-[5-[(2-butyl-4-oxo-1,3-diazaspiro[4.4]non-1-en-3-yl)methyl]-2-[2-[(3,4-dimethyl-1,2-oxazol-5-yl)sulfamoyl]phenyl]phenyl]-3,3-dimethylbutanamide |
| SMILES | CCCCC1=NC2(CCCC2)C(=O)N1Cc1ccc(-c2ccccc2S(=O)(=O)Nc2onc(C)c2C)c(NC(=O)CC(C)(C)C)c1 |
| InChI | InChI=1S/C35H45N5O5S/c1-7-8-15-30-37-35(18-11-12-19-35)33(42)40(30)22-25-16-17-26(28(20-25)36-31(41)21-34(4,5)6)27-13-9-10-14-29(27)46(43,44)39-32-23(2)24(3)38-45-32/h9-10,13-14,16-17,20,39H,7-8,11-12,15,18-19,21-22H2,1-6H3,(H,36,41) |
| InChIKey | WTRFAYFYRSWSBW-UHFFFAOYSA-N |
| XLogP | 7.38 |
| TPSA | 133.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 647.84 |
| LogP ≤ 5 | 7.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |