C36H44N4O20 — CID 20747703
2-[1,3-bis[2-[(2,5-dioxopyrrol-1-yl)methoxymethoxy]ethoxy]-2-[2-[(2,5-dioxopyrrol-1-yl)methoxymethoxy]ethoxymethyl]propan-2-yl]oxyethyl 2-(2,5-dioxopyrrol-1-yl)acetate (PubChem CID 20747703) has the molecular formula C36H44N4O20 and a molecular weight of 852.76 g/mol. Its IUPAC name is 2-[1,3-bis[2-[(2,5-dioxopyrrol-1-yl)methoxymethoxy]ethoxy]-2-[2-[(2,5-dioxopyrrol-1-yl)methoxymethoxy]ethoxymethyl]propan-2-yl]oxyethyl 2-(2,5-dioxopyrrol-1-yl)acetate.
| Compound Name | 2-[1,3-bis[2-[(2,5-dioxopyrrol-1-yl)methoxymethoxy]ethoxy]-2-[2-[(2,5-dioxopyrrol-1-yl)methoxymethoxy]ethoxymethyl]propan-2-yl]oxyethyl 2-(2,5-dioxopyrrol-1-yl)acetate |
|---|---|
| PubChem CID | 20747703 |
| Molecular Formula | C36H44N4O20 |
| Molecular Weight | 852.76 g/mol |
| Exact Mass | 852.25 |
| IUPAC Name | 2-[1,3-bis[2-[(2,5-dioxopyrrol-1-yl)methoxymethoxy]ethoxy]-2-[2-[(2,5-dioxopyrrol-1-yl)methoxymethoxy]ethoxymethyl]propan-2-yl]oxyethyl 2-(2,5-dioxopyrrol-1-yl)acetate |
| SMILES | O=C(CN1C(=O)C=CC1=O)OCCOC(COCCOCOCN1C(=O)C=CC1=O)(COCCOCOCN1C(=O)C=CC1=O)COCCOCOCN1C(=O)C=CC1=O |
| InChI | InChI=1S/C36H44N4O20/c41-27-1-2-28(42)37(27)17-35(49)59-15-16-60-36(18-50-9-12-53-24-56-21-38-29(43)3-4-30(38)44,19-51-10-13-54-25-57-22-39-31(45)5-6-32(39)46)20-52-11-14-55-26-58-23-40-33(47)7-8-34(40)48/h1-8H,9-26H2 |
| InChIKey | IFZONAOKGVSQKH-UHFFFAOYSA-N |
| XLogP | -3.12 |
| TPSA | 268.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 20 |
| Rotatable Bonds | 33 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 852.76 |
| LogP ≤ 5 | -3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 20 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|