C43H28F8O4 — CID 20747717
(2,3,5,6-tetrafluoro-4-methylphenyl)-[4-[4-[2,3,5,6-tetrafluoro-4-[4-[2-(4-methylphenyl)propan-2-yl]phenoxy]benzoyl]phenoxy]phenyl]methanone (PubChem CID 20747717) has the molecular formula C43H28F8O4 and a molecular weight of 760.68 g/mol. Its IUPAC name is (2,3,5,6-tetrafluoro-4-methylphenyl)-[4-[4-[2,3,5,6-tetrafluoro-4-[4-[2-(4-methylphenyl)propan-2-yl]phenoxy]benzoyl]phenoxy]phenyl]methanone.
| Compound Name | (2,3,5,6-tetrafluoro-4-methylphenyl)-[4-[4-[2,3,5,6-tetrafluoro-4-[4-[2-(4-methylphenyl)propan-2-yl]phenoxy]benzoyl]phenoxy]phenyl]methanone |
|---|---|
| PubChem CID | 20747717 |
| Molecular Formula | C43H28F8O4 |
| Molecular Weight | 760.68 g/mol |
| Exact Mass | 760.19 |
| IUPAC Name | (2,3,5,6-tetrafluoro-4-methylphenyl)-[4-[4-[2,3,5,6-tetrafluoro-4-[4-[2-(4-methylphenyl)propan-2-yl]phenoxy]benzoyl]phenoxy]phenyl]methanone |
| SMILES | Cc1ccc(C(C)(C)c2ccc(Oc3c(F)c(F)c(C(=O)c4ccc(Oc5ccc(C(=O)c6c(F)c(F)c(C)c(F)c6F)cc5)cc4)c(F)c3F)cc2)cc1 |
| InChI | InChI=1S/C43H28F8O4/c1-21-5-11-25(12-6-21)43(3,4)26-13-19-29(20-14-26)55-42-38(50)36(48)31(37(49)39(42)51)41(53)24-9-17-28(18-10-24)54-27-15-7-23(8-16-27)40(52)30-34(46)32(44)22(2)33(45)35(30)47/h5-20H,1-4H3 |
| InChIKey | DBQLCMWZNLDZHO-UHFFFAOYSA-N |
| XLogP | 11.79 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 760.68 |
| LogP ≤ 5 | 11.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|