C46H32F8O4 — CID 20747718
(2,3,5,6-tetrafluoro-4-methylphenyl)-[4-[4-[2,3,5,6-tetrafluoro-4-[4-[4-(4-methylphenyl)cyclohexyl]phenoxy]benzoyl]phenoxy]phenyl]methanone (PubChem CID 20747718) has the molecular formula C46H32F8O4 and a molecular weight of 800.74 g/mol. Its IUPAC name is (2,3,5,6-tetrafluoro-4-methylphenyl)-[4-[4-[2,3,5,6-tetrafluoro-4-[4-[4-(4-methylphenyl)cyclohexyl]phenoxy]benzoyl]phenoxy]phenyl]methanone.
| Compound Name | (2,3,5,6-tetrafluoro-4-methylphenyl)-[4-[4-[2,3,5,6-tetrafluoro-4-[4-[4-(4-methylphenyl)cyclohexyl]phenoxy]benzoyl]phenoxy]phenyl]methanone |
|---|---|
| PubChem CID | 20747718 |
| Molecular Formula | C46H32F8O4 |
| Molecular Weight | 800.74 g/mol |
| Exact Mass | 800.22 |
| IUPAC Name | (2,3,5,6-tetrafluoro-4-methylphenyl)-[4-[4-[2,3,5,6-tetrafluoro-4-[4-[4-(4-methylphenyl)cyclohexyl]phenoxy]benzoyl]phenoxy]phenyl]methanone |
| SMILES | Cc1ccc(C2CCC(c3ccc(Oc4c(F)c(F)c(C(=O)c5ccc(Oc6ccc(C(=O)c7c(F)c(F)c(C)c(F)c7F)cc6)cc5)c(F)c4F)cc3)CC2)cc1 |
| InChI | InChI=1S/C46H32F8O4/c1-23-3-5-25(6-4-23)26-7-9-27(10-8-26)28-11-17-33(18-12-28)58-46-42(53)40(51)35(41(52)43(46)54)45(56)30-15-21-32(22-16-30)57-31-19-13-29(14-20-31)44(55)34-38(49)36(47)24(2)37(48)39(34)50/h3-6,11-22,26-27H,7-10H2,1-2H3 |
| InChIKey | DVTKERSEQKYXHJ-UHFFFAOYSA-N |
| XLogP | 12.90 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 800.74 |
| LogP ≤ 5 | 12.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|