About 2-(3H-1-benzothiophen-3-id-2-yl)pyridine;yttrium;zinc
2-(3H-1-benzothiophen-3-id-2-yl)pyridine;yttrium;zinc (PubChem CID 20747772) has the molecular formula C13H8NSYZn-
and a molecular weight of 364.58 g/mol. Its IUPAC name is 2-(3H-1-benzothiophen-3-id-2-yl)pyridine;yttrium;zinc.
Molecular Properties
| Compound Name | 2-(3H-1-benzothiophen-3-id-2-yl)pyridine;yttrium;zinc |
| PubChem CID | 20747772 |
| Molecular Formula | C13H8NSYZn- |
| Molecular Weight | 364.58 g/mol |
| Exact Mass | 362.87 |
| IUPAC Name | 2-(3H-1-benzothiophen-3-id-2-yl)pyridine;yttrium;zinc |
| SMILES | [Y].[Zn].[c-]1c(-c2ccccn2)sc2ccccc12 |
| InChI | InChI=1S/C13H8NS.Y.Zn/c1-2-7-12-10(5-1)9-13(15-12)11-6-3-4-8-14-11;;/h1-8H;;/q-1;; |
| InChIKey | SDUNWTHYZBNOQK-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 364.58 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 2-(3H-1-benzothiophen-3-id-2-yl)pyridine;yttrium;zinc with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3H-1-benzothiophen-3-id-2-yl)pyridine;yttrium;zinc?
The IUPAC name of 2-(3H-1-benzothiophen-3-id-2-yl)pyridine;yttrium;zinc (CID 20747772) is 2-(3H-1-benzothiophen-3-id-2-yl)pyridine;yttrium;zinc.
What is the SMILES notation for 2-(3H-1-benzothiophen-3-id-2-yl)pyridine;yttrium;zinc?
The canonical SMILES for 2-(3H-1-benzothiophen-3-id-2-yl)pyridine;yttrium;zinc is [Y].[Zn].[c-]1c(-c2ccccn2)sc2ccccc12.
What is the InChIKey of 2-(3H-1-benzothiophen-3-id-2-yl)pyridine;yttrium;zinc?
The InChIKey is SDUNWTHYZBNOQK-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H8NS.Y.Zn/c1-2-7-12-10(5-1)9-13(15-12)11-6-3-4-8-14-11;;/h1-8H;;/q-1;;.
What are the key properties of 2-(3H-1-benzothiophen-3-id-2-yl)pyridine;yttrium;zinc?
2-(3H-1-benzothiophen-3-id-2-yl)pyridine;yttrium;zinc has a molecular weight of 364.58 g/mol, XLogP of 3.76, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3H-1-benzothiophen-3-id-2-yl)pyridine;yttrium;zinc is sourced from PubChem (CID 20747772), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).