About 7,8-ditert-butyl-1,4-dioxaspiro[4.5]decane
7,8-ditert-butyl-1,4-dioxaspiro[4.5]decane (PubChem CID 20747800) has the molecular formula C16H30O2
and a molecular weight of 254.41 g/mol. Its IUPAC name is 7,8-ditert-butyl-1,4-dioxaspiro[4.5]decane.
Molecular Properties
| Compound Name | 7,8-ditert-butyl-1,4-dioxaspiro[4.5]decane |
| PubChem CID | 20747800 |
| Molecular Formula | C16H30O2 |
| Molecular Weight | 254.41 g/mol |
| Exact Mass | 254.22 |
| IUPAC Name | 7,8-ditert-butyl-1,4-dioxaspiro[4.5]decane |
| SMILES | CC(C)(C)C1CCC2(CC1C(C)(C)C)OCCO2 |
| InChI | InChI=1S/C16H30O2/c1-14(2,3)12-7-8-16(17-9-10-18-16)11-13(12)15(4,5)6/h12-13H,7-11H2,1-6H3 |
| InChIKey | MRWNGOLFVXZUDZ-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.41 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 7,8-ditert-butyl-1,4-dioxaspiro[4.5]decane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7,8-ditert-butyl-1,4-dioxaspiro[4.5]decane?
The IUPAC name of 7,8-ditert-butyl-1,4-dioxaspiro[4.5]decane (CID 20747800) is 7,8-ditert-butyl-1,4-dioxaspiro[4.5]decane.
What is the SMILES notation for 7,8-ditert-butyl-1,4-dioxaspiro[4.5]decane?
The canonical SMILES for 7,8-ditert-butyl-1,4-dioxaspiro[4.5]decane is CC(C)(C)C1CCC2(CC1C(C)(C)C)OCCO2.
What is the InChIKey of 7,8-ditert-butyl-1,4-dioxaspiro[4.5]decane?
The InChIKey is MRWNGOLFVXZUDZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H30O2/c1-14(2,3)12-7-8-16(17-9-10-18-16)11-13(12)15(4,5)6/h12-13H,7-11H2,1-6H3.
What are the key properties of 7,8-ditert-butyl-1,4-dioxaspiro[4.5]decane?
7,8-ditert-butyl-1,4-dioxaspiro[4.5]decane has a molecular weight of 254.41 g/mol, XLogP of 4.24, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7,8-ditert-butyl-1,4-dioxaspiro[4.5]decane is sourced from PubChem (CID 20747800), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).