About 2-ethyl-4-(methoxymethyl)-1,3-dithiolane
2-ethyl-4-(methoxymethyl)-1,3-dithiolane (PubChem CID 20747826) has the molecular formula C7H14OS2
and a molecular weight of 178.32 g/mol. Its IUPAC name is 2-ethyl-4-(methoxymethyl)-1,3-dithiolane.
Molecular Properties
| Compound Name | 2-ethyl-4-(methoxymethyl)-1,3-dithiolane |
| PubChem CID | 20747826 |
| Molecular Formula | C7H14OS2 |
| Molecular Weight | 178.32 g/mol |
| Exact Mass | 178.05 |
| IUPAC Name | 2-ethyl-4-(methoxymethyl)-1,3-dithiolane |
| SMILES | CCC1SCC(COC)S1 |
| InChI | InChI=1S/C7H14OS2/c1-3-7-9-5-6(10-7)4-8-2/h6-7H,3-5H2,1-2H3 |
| InChIKey | MJWMXZZDNKNABS-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.32 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-ethyl-4-(methoxymethyl)-1,3-dithiolane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethyl-4-(methoxymethyl)-1,3-dithiolane?
The IUPAC name of 2-ethyl-4-(methoxymethyl)-1,3-dithiolane (CID 20747826) is 2-ethyl-4-(methoxymethyl)-1,3-dithiolane.
What is the SMILES notation for 2-ethyl-4-(methoxymethyl)-1,3-dithiolane?
The canonical SMILES for 2-ethyl-4-(methoxymethyl)-1,3-dithiolane is CCC1SCC(COC)S1.
What is the InChIKey of 2-ethyl-4-(methoxymethyl)-1,3-dithiolane?
The InChIKey is MJWMXZZDNKNABS-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14OS2/c1-3-7-9-5-6(10-7)4-8-2/h6-7H,3-5H2,1-2H3.
What are the key properties of 2-ethyl-4-(methoxymethyl)-1,3-dithiolane?
2-ethyl-4-(methoxymethyl)-1,3-dithiolane has a molecular weight of 178.32 g/mol, XLogP of 2.22, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethyl-4-(methoxymethyl)-1,3-dithiolane is sourced from PubChem (CID 20747826), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).