C19H25ClN2O4S — CID 20747907
O-[5-[1-chloro-2-[2-(2-methylphenoxy)ethylamino]propyl]-2-methoxyphenyl]sulfanyloxyhydroxylamine (PubChem CID 20747907) has the molecular formula C19H25ClN2O4S and a molecular weight of 412.94 g/mol. Its IUPAC name is O-[5-[1-chloro-2-[2-(2-methylphenoxy)ethylamino]propyl]-2-methoxyphenyl]sulfanyloxyhydroxylamine.
| Compound Name | O-[5-[1-chloro-2-[2-(2-methylphenoxy)ethylamino]propyl]-2-methoxyphenyl]sulfanyloxyhydroxylamine |
|---|---|
| PubChem CID | 20747907 |
| Molecular Formula | C19H25ClN2O4S |
| Molecular Weight | 412.94 g/mol |
| Exact Mass | 412.12 |
| IUPAC Name | O-[5-[1-chloro-2-[2-(2-methylphenoxy)ethylamino]propyl]-2-methoxyphenyl]sulfanyloxyhydroxylamine |
| SMILES | COc1ccc(C(Cl)C(C)NCCOc2ccccc2C)cc1SOON |
| InChI | InChI=1S/C19H25ClN2O4S/c1-13-6-4-5-7-16(13)24-11-10-22-14(2)19(20)15-8-9-17(23-3)18(12-15)27-26-25-21/h4-9,12,14,19,22H,10-11,21H2,1-3H3 |
| InChIKey | GDXOZCREVHRYQM-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 74.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.94 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|