C24H44O7 — CID 20748203
1-O-(2-hydroxyethyl) 5-O-methyl 3-O-octan-3-yl 1,1,5-trimethylheptane-1,3,5-tricarboxylate (PubChem CID 20748203) has the molecular formula C24H44O7 and a molecular weight of 444.61 g/mol. Its IUPAC name is 1-O-(2-hydroxyethyl) 5-O-methyl 3-O-octan-3-yl 1,1,5-trimethylheptane-1,3,5-tricarboxylate.
| Compound Name | 1-O-(2-hydroxyethyl) 5-O-methyl 3-O-octan-3-yl 1,1,5-trimethylheptane-1,3,5-tricarboxylate |
|---|---|
| PubChem CID | 20748203 |
| Molecular Formula | C24H44O7 |
| Molecular Weight | 444.61 g/mol |
| Exact Mass | 444.31 |
| IUPAC Name | 1-O-(2-hydroxyethyl) 5-O-methyl 3-O-octan-3-yl 1,1,5-trimethylheptane-1,3,5-tricarboxylate |
| SMILES | CCCCCC(CC)OC(=O)C(CC(C)(C)C(=O)OCCO)CC(C)(CC)C(=O)OC |
| InChI | InChI=1S/C24H44O7/c1-8-11-12-13-19(9-2)31-20(26)18(17-24(6,10-3)22(28)29-7)16-23(4,5)21(27)30-15-14-25/h18-19,25H,8-17H2,1-7H3 |
| InChIKey | XZQYJKQJRMCDLD-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.61 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|