C26H46O9 — CID 20748204
3-O-butyl 5-O-ethyl 1-O-(2-hydroxyethyl) 7-O-methyl 1,1,5,7-tetramethylnonane-1,3,5,7-tetracarboxylate (PubChem CID 20748204) has the molecular formula C26H46O9 and a molecular weight of 502.65 g/mol. Its IUPAC name is 3-O-butyl 5-O-ethyl 1-O-(2-hydroxyethyl) 7-O-methyl 1,1,5,7-tetramethylnonane-1,3,5,7-tetracarboxylate.
| Compound Name | 3-O-butyl 5-O-ethyl 1-O-(2-hydroxyethyl) 7-O-methyl 1,1,5,7-tetramethylnonane-1,3,5,7-tetracarboxylate |
|---|---|
| PubChem CID | 20748204 |
| Molecular Formula | C26H46O9 |
| Molecular Weight | 502.65 g/mol |
| Exact Mass | 502.31 |
| IUPAC Name | 3-O-butyl 5-O-ethyl 1-O-(2-hydroxyethyl) 7-O-methyl 1,1,5,7-tetramethylnonane-1,3,5,7-tetracarboxylate |
| SMILES | CCCCOC(=O)C(CC(C)(C)C(=O)OCCO)CC(C)(CC(C)(CC)C(=O)OC)C(=O)OCC |
| InChI | InChI=1S/C26H46O9/c1-9-12-14-34-20(28)19(16-24(4,5)21(29)35-15-13-27)17-26(7,23(31)33-11-3)18-25(6,10-2)22(30)32-8/h19,27H,9-18H2,1-8H3 |
| InChIKey | WGBNELWSZZLNGF-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 125.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.65 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|