About N-[2-(1,2-dimethyl-4,5-dihydroimidazol-1-ium-1-yl)ethyl]acetamide
N-[2-(1,2-dimethyl-4,5-dihydroimidazol-1-ium-1-yl)ethyl]acetamide (PubChem CID 20748345) has the molecular formula C9H18N3O+
and a molecular weight of 184.26 g/mol. Its IUPAC name is N-[2-(1,2-dimethyl-4,5-dihydroimidazol-1-ium-1-yl)ethyl]acetamide.
Molecular Properties
| Compound Name | N-[2-(1,2-dimethyl-4,5-dihydroimidazol-1-ium-1-yl)ethyl]acetamide |
| PubChem CID | 20748345 |
| Molecular Formula | C9H18N3O+ |
| Molecular Weight | 184.26 g/mol |
| Exact Mass | 184.14 |
| IUPAC Name | N-[2-(1,2-dimethyl-4,5-dihydroimidazol-1-ium-1-yl)ethyl]acetamide |
| SMILES | CC(=O)NCC[N+]1(C)CCN=C1C |
| InChI | InChI=1S/C9H17N3O/c1-8-10-4-6-12(8,3)7-5-11-9(2)13/h4-7H2,1-3H3/p+1 |
| InChIKey | UAKZARCBMSWRHM-UHFFFAOYSA-O |
| XLogP | 0.00 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.26 |
| LogP ≤ 5 | 0.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze N-[2-(1,2-dimethyl-4,5-dihydroimidazol-1-ium-1-yl)ethyl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-(1,2-dimethyl-4,5-dihydroimidazol-1-ium-1-yl)ethyl]acetamide?
The IUPAC name of N-[2-(1,2-dimethyl-4,5-dihydroimidazol-1-ium-1-yl)ethyl]acetamide (CID 20748345) is N-[2-(1,2-dimethyl-4,5-dihydroimidazol-1-ium-1-yl)ethyl]acetamide.
What is the SMILES notation for N-[2-(1,2-dimethyl-4,5-dihydroimidazol-1-ium-1-yl)ethyl]acetamide?
The canonical SMILES for N-[2-(1,2-dimethyl-4,5-dihydroimidazol-1-ium-1-yl)ethyl]acetamide is CC(=O)NCC[N+]1(C)CCN=C1C.
What is the InChIKey of N-[2-(1,2-dimethyl-4,5-dihydroimidazol-1-ium-1-yl)ethyl]acetamide?
The InChIKey is UAKZARCBMSWRHM-UHFFFAOYSA-O. The full InChI is InChI=1S/C9H17N3O/c1-8-10-4-6-12(8,3)7-5-11-9(2)13/h4-7H2,1-3H3/p+1.
What are the key properties of N-[2-(1,2-dimethyl-4,5-dihydroimidazol-1-ium-1-yl)ethyl]acetamide?
N-[2-(1,2-dimethyl-4,5-dihydroimidazol-1-ium-1-yl)ethyl]acetamide has a molecular weight of 184.26 g/mol, XLogP of 0.00, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-(1,2-dimethyl-4,5-dihydroimidazol-1-ium-1-yl)ethyl]acetamide is sourced from PubChem (CID 20748345), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).