About ethyl 4-[4-[2-[(6-bromo-1,3-benzothiazol-2-yl)amino]propyl]phenoxy]butanoate
ethyl 4-[4-[2-[(6-bromo-1,3-benzothiazol-2-yl)amino]propyl]phenoxy]butanoate (PubChem CID 20748405) has the molecular formula C22H25BrN2O3S
and a molecular weight of 477.42 g/mol. Its IUPAC name is ethyl 4-[4-[2-[(6-bromo-1,3-benzothiazol-2-yl)amino]propyl]phenoxy]butanoate.
Molecular Properties
| Compound Name | ethyl 4-[4-[2-[(6-bromo-1,3-benzothiazol-2-yl)amino]propyl]phenoxy]butanoate |
| PubChem CID | 20748405 |
| Molecular Formula | C22H25BrN2O3S |
| Molecular Weight | 477.42 g/mol |
| Exact Mass | 476.08 |
| IUPAC Name | ethyl 4-[4-[2-[(6-bromo-1,3-benzothiazol-2-yl)amino]propyl]phenoxy]butanoate |
| SMILES | CCOC(=O)CCCOc1ccc(CC(C)Nc2nc3ccc(Br)cc3s2)cc1 |
| InChI | InChI=1S/C22H25BrN2O3S/c1-3-27-21(26)5-4-12-28-18-9-6-16(7-10-18)13-15(2)24-22-25-19-11-8-17(23)14-20(19)29-22/h6-11,14-15H,3-5,12-13H2,1-2H3,(H,24,25) |
| InChIKey | ONIBCFRNFNXUDL-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 477.42 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze ethyl 4-[4-[2-[(6-bromo-1,3-benzothiazol-2-yl)amino]propyl]phenoxy]butanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 4-[4-[2-[(6-bromo-1,3-benzothiazol-2-yl)amino]propyl]phenoxy]butanoate?
The IUPAC name of ethyl 4-[4-[2-[(6-bromo-1,3-benzothiazol-2-yl)amino]propyl]phenoxy]butanoate (CID 20748405) is ethyl 4-[4-[2-[(6-bromo-1,3-benzothiazol-2-yl)amino]propyl]phenoxy]butanoate.
What is the SMILES notation for ethyl 4-[4-[2-[(6-bromo-1,3-benzothiazol-2-yl)amino]propyl]phenoxy]butanoate?
The canonical SMILES for ethyl 4-[4-[2-[(6-bromo-1,3-benzothiazol-2-yl)amino]propyl]phenoxy]butanoate is CCOC(=O)CCCOc1ccc(CC(C)Nc2nc3ccc(Br)cc3s2)cc1.
What is the InChIKey of ethyl 4-[4-[2-[(6-bromo-1,3-benzothiazol-2-yl)amino]propyl]phenoxy]butanoate?
The InChIKey is ONIBCFRNFNXUDL-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H25BrN2O3S/c1-3-27-21(26)5-4-12-28-18-9-6-16(7-10-18)13-15(2)24-22-25-19-11-8-17(23)14-20(19)29-22/h6-11,14-15H,3-5,12-13H2,1-2H3,(H,24,25).
What are the key properties of ethyl 4-[4-[2-[(6-bromo-1,3-benzothiazol-2-yl)amino]propyl]phenoxy]butanoate?
ethyl 4-[4-[2-[(6-bromo-1,3-benzothiazol-2-yl)amino]propyl]phenoxy]butanoate has a molecular weight of 477.42 g/mol, XLogP of 5.82, 10 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 4-[4-[2-[(6-bromo-1,3-benzothiazol-2-yl)amino]propyl]phenoxy]butanoate is sourced from PubChem (CID 20748405), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).