C22H26N2O4 — CID 20748521
2-N-[(2-methylpropan-2-yl)oxy]-1-(4-phenylmethoxyphenyl)cyclopropane-1,2-dicarboxamide (PubChem CID 20748521) has the molecular formula C22H26N2O4 and a molecular weight of 382.46 g/mol. Its IUPAC name is 2-N-[(2-methylpropan-2-yl)oxy]-1-(4-phenylmethoxyphenyl)cyclopropane-1,2-dicarboxamide.
| Compound Name | 2-N-[(2-methylpropan-2-yl)oxy]-1-(4-phenylmethoxyphenyl)cyclopropane-1,2-dicarboxamide |
|---|---|
| PubChem CID | 20748521 |
| Molecular Formula | C22H26N2O4 |
| Molecular Weight | 382.46 g/mol |
| Exact Mass | 382.19 |
| IUPAC Name | 2-N-[(2-methylpropan-2-yl)oxy]-1-(4-phenylmethoxyphenyl)cyclopropane-1,2-dicarboxamide |
| SMILES | CC(C)(C)ONC(=O)C1CC1(C(N)=O)c1ccc(OCc2ccccc2)cc1 |
| InChI | InChI=1S/C22H26N2O4/c1-21(2,3)28-24-19(25)18-13-22(18,20(23)26)16-9-11-17(12-10-16)27-14-15-7-5-4-6-8-15/h4-12,18H,13-14H2,1-3H3,(H2,23,26)(H,24,25) |
| InChIKey | PKGRJGYUFKIDNN-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.46 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|