About Prifinium Bromide
Prifinium Bromide (PubChem CID 20749) has the molecular formula C22H28BrN
and a molecular weight of 386.40 g/mol. Its IUPAC name is 3-benzhydrylidene-1,1-diethyl-2-methylpyrrolidin-1-ium bromide.
Molecular Properties
| Compound Name | Prifinium Bromide |
| PubChem CID | 20749 |
| Molecular Formula | C22H28BrN |
| Molecular Weight | 386.40 g/mol |
| Exact Mass | 385.14 |
| IUPAC Name | 3-benzhydrylidene-1,1-diethyl-2-methylpyrrolidin-1-ium bromide |
| SMILES | CC[N+]1(CCC(=C(C2=CC=CC=C2)C3=CC=CC=C3)C1C)CC.[Br-] |
| InChI | InChI=1S/C22H28N.BrH/c1-4-23(5-2)17-16-21(18(23)3)22(19-12-8-6-9-13-19)20-14-10-7-11-15-20;/h6-15,18H,4-5,16-17H2,1-3H3;1H/q+1;/p-1 |
| InChIKey | UCGJZJXOPSNTGZ-UHFFFAOYSA-M |
| XLogP | — |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | 386 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 386.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze Prifinium Bromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Prifinium Bromide?
The IUPAC name of Prifinium Bromide (CID 20749) is 3-benzhydrylidene-1,1-diethyl-2-methylpyrrolidin-1-ium bromide.
What is the SMILES notation for Prifinium Bromide?
The canonical SMILES for Prifinium Bromide is CC[N+]1(CCC(=C(C2=CC=CC=C2)C3=CC=CC=C3)C1C)CC.[Br-].
What is the InChIKey of Prifinium Bromide?
The InChIKey is UCGJZJXOPSNTGZ-UHFFFAOYSA-M. The full InChI is InChI=1S/C22H28N.BrH/c1-4-23(5-2)17-16-21(18(23)3)22(19-12-8-6-9-13-19)20-14-10-7-11-15-20;/h6-15,18H,4-5,16-17H2,1-3H3;1H/q+1;/p-1.
What are the key properties of Prifinium Bromide?
Prifinium Bromide has a molecular weight of 386.40 g/mol, XLogP of not available, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for Prifinium Bromide is sourced from PubChem (CID 20749), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).