About dichloro-[3-(4,6-dimethyl-2-pyridinyl)propylidene]ruthenium;tri(propan-2-yl)phosphanium
dichloro-[3-(4,6-dimethyl-2-pyridinyl)propylidene]ruthenium;tri(propan-2-yl)phosphanium (PubChem CID 20749001) has the molecular formula C19H35Cl2NPRu+
and a molecular weight of 480.45 g/mol. Its IUPAC name is dichloro-[3-(4,6-dimethyl-2-pyridinyl)propylidene]ruthenium;tri(propan-2-yl)phosphanium.
Molecular Properties
| Compound Name | dichloro-[3-(4,6-dimethyl-2-pyridinyl)propylidene]ruthenium;tri(propan-2-yl)phosphanium |
| PubChem CID | 20749001 |
| Molecular Formula | C19H35Cl2NPRu+ |
| Molecular Weight | 480.45 g/mol |
| Exact Mass | 480.09 |
| IUPAC Name | dichloro-[3-(4,6-dimethyl-2-pyridinyl)propylidene]ruthenium;tri(propan-2-yl)phosphanium |
| SMILES | CC(C)[PH+](C(C)C)C(C)C.Cc1cc(C)nc(CCC=[Ru](Cl)Cl)c1 |
| InChI | InChI=1S/C10H13N.C9H21P.2ClH.Ru/c1-4-5-10-7-8(2)6-9(3)11-10;1-7(2)10(8(3)4)9(5)6;;;/h1,6-7H,4-5H2,2-3H3;7-9H,1-6H3;2*1H;/q;;;;+2/p-1 |
| InChIKey | OAXUJEDZPCTOQI-UHFFFAOYSA-M |
| XLogP | 6.78 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 480.45 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze dichloro-[3-(4,6-dimethyl-2-pyridinyl)propylidene]ruthenium;tri(propan-2-yl)phosphanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dichloro-[3-(4,6-dimethyl-2-pyridinyl)propylidene]ruthenium;tri(propan-2-yl)phosphanium?
The IUPAC name of dichloro-[3-(4,6-dimethyl-2-pyridinyl)propylidene]ruthenium;tri(propan-2-yl)phosphanium (CID 20749001) is dichloro-[3-(4,6-dimethyl-2-pyridinyl)propylidene]ruthenium;tri(propan-2-yl)phosphanium.
What is the SMILES notation for dichloro-[3-(4,6-dimethyl-2-pyridinyl)propylidene]ruthenium;tri(propan-2-yl)phosphanium?
The canonical SMILES for dichloro-[3-(4,6-dimethyl-2-pyridinyl)propylidene]ruthenium;tri(propan-2-yl)phosphanium is CC(C)[PH+](C(C)C)C(C)C.Cc1cc(C)nc(CCC=[Ru](Cl)Cl)c1.
What is the InChIKey of dichloro-[3-(4,6-dimethyl-2-pyridinyl)propylidene]ruthenium;tri(propan-2-yl)phosphanium?
The InChIKey is OAXUJEDZPCTOQI-UHFFFAOYSA-M. The full InChI is InChI=1S/C10H13N.C9H21P.2ClH.Ru/c1-4-5-10-7-8(2)6-9(3)11-10;1-7(2)10(8(3)4)9(5)6;;;/h1,6-7H,4-5H2,2-3H3;7-9H,1-6H3;2*1H;/q;;;;+2/p-1.
What are the key properties of dichloro-[3-(4,6-dimethyl-2-pyridinyl)propylidene]ruthenium;tri(propan-2-yl)phosphanium?
dichloro-[3-(4,6-dimethyl-2-pyridinyl)propylidene]ruthenium;tri(propan-2-yl)phosphanium has a molecular weight of 480.45 g/mol, XLogP of 6.78, 6 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for dichloro-[3-(4,6-dimethyl-2-pyridinyl)propylidene]ruthenium;tri(propan-2-yl)phosphanium is sourced from PubChem (CID 20749001), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).