C24H34N2 — CID 20749003
2,4,5-trimethyl-1,3-bis(2,4,6-trimethylphenyl)imidazolidine (PubChem CID 20749003) has the molecular formula C24H34N2 and a molecular weight of 350.55 g/mol. Its IUPAC name is 2,4,5-trimethyl-1,3-bis(2,4,6-trimethylphenyl)imidazolidine.
| Compound Name | 2,4,5-trimethyl-1,3-bis(2,4,6-trimethylphenyl)imidazolidine |
|---|---|
| PubChem CID | 20749003 |
| Molecular Formula | C24H34N2 |
| Molecular Weight | 350.55 g/mol |
| Exact Mass | 350.27 |
| IUPAC Name | 2,4,5-trimethyl-1,3-bis(2,4,6-trimethylphenyl)imidazolidine |
| SMILES | Cc1cc(C)c(N2C(C)C(C)N(c3c(C)cc(C)cc3C)C2C)c(C)c1 |
| InChI | InChI=1S/C24H34N2/c1-14-10-16(3)23(17(4)11-14)25-20(7)21(8)26(22(25)9)24-18(5)12-15(2)13-19(24)6/h10-13,20-22H,1-9H3 |
| InChIKey | BHSNYUSQLLLEKU-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.55 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |