About 1,3-dimethyl-3a,4,5,6,7,7a-hexahydro-2H-benzimidazole
1,3-dimethyl-3a,4,5,6,7,7a-hexahydro-2H-benzimidazole (PubChem CID 20749021) has the molecular formula C9H18N2
and a molecular weight of 154.26 g/mol. Its IUPAC name is 1,3-dimethyl-3a,4,5,6,7,7a-hexahydro-2H-benzimidazole.
Analyze 1,3-dimethyl-3a,4,5,6,7,7a-hexahydro-2H-benzimidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-dimethyl-3a,4,5,6,7,7a-hexahydro-2H-benzimidazole?
The IUPAC name of 1,3-dimethyl-3a,4,5,6,7,7a-hexahydro-2H-benzimidazole (CID 20749021) is 1,3-dimethyl-3a,4,5,6,7,7a-hexahydro-2H-benzimidazole.
What is the SMILES notation for 1,3-dimethyl-3a,4,5,6,7,7a-hexahydro-2H-benzimidazole?
The canonical SMILES for 1,3-dimethyl-3a,4,5,6,7,7a-hexahydro-2H-benzimidazole is CN1CN(C)C2CCCCC21.
What is the InChIKey of 1,3-dimethyl-3a,4,5,6,7,7a-hexahydro-2H-benzimidazole?
The InChIKey is SCCRHBSDEKGLDA-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18N2/c1-10-7-11(2)9-6-4-3-5-8(9)10/h8-9H,3-7H2,1-2H3.
What are the key properties of 1,3-dimethyl-3a,4,5,6,7,7a-hexahydro-2H-benzimidazole?
1,3-dimethyl-3a,4,5,6,7,7a-hexahydro-2H-benzimidazole has a molecular weight of 154.26 g/mol, XLogP of 1.13, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-dimethyl-3a,4,5,6,7,7a-hexahydro-2H-benzimidazole is sourced from PubChem (CID 20749021), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).