C3H2F6O2S — CID 20749593
1,1,2,2,3-pentafluoropropane-1-sulfonyl fluoride (PubChem CID 20749593) has the molecular formula C3H2F6O2S and a molecular weight of 216.10 g/mol. Its IUPAC name is 1,1,2,2,3-pentafluoropropane-1-sulfonyl fluoride.
| Compound Name | 1,1,2,2,3-pentafluoropropane-1-sulfonyl fluoride |
|---|---|
| PubChem CID | 20749593 |
| Molecular Formula | C3H2F6O2S |
| Molecular Weight | 216.10 g/mol |
| Exact Mass | 215.97 |
| IUPAC Name | 1,1,2,2,3-pentafluoropropane-1-sulfonyl fluoride |
| SMILES | O=S(=O)(F)C(F)(F)C(F)(F)CF |
| InChI | InChI=1S/C3H2F6O2S/c4-1-2(5,6)3(7,8)12(9,10)11/h1H2 |
| InChIKey | DUSXVHNXLUYDBK-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.10 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|