About 2-hydroxy-4,4-dimethylpentane-1-sulfonate
2-hydroxy-4,4-dimethylpentane-1-sulfonate (PubChem CID 20749602) has the molecular formula C7H15O4S-
and a molecular weight of 195.26 g/mol. Its IUPAC name is 2-hydroxy-4,4-dimethylpentane-1-sulfonate.
Molecular Properties
| Compound Name | 2-hydroxy-4,4-dimethylpentane-1-sulfonate |
| PubChem CID | 20749602 |
| Molecular Formula | C7H15O4S- |
| Molecular Weight | 195.26 g/mol |
| Exact Mass | 195.07 |
| IUPAC Name | 2-hydroxy-4,4-dimethylpentane-1-sulfonate |
| SMILES | CC(C)(C)CC(O)CS(=O)(=O)[O-] |
| InChI | InChI=1S/C7H16O4S/c1-7(2,3)4-6(8)5-12(9,10)11/h6,8H,4-5H2,1-3H3,(H,9,10,11)/p-1 |
| InChIKey | BJUUGGIREVLSGJ-UHFFFAOYSA-M |
| XLogP | 0.33 |
| TPSA | 77.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.26 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 2-hydroxy-4,4-dimethylpentane-1-sulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hydroxy-4,4-dimethylpentane-1-sulfonate?
The IUPAC name of 2-hydroxy-4,4-dimethylpentane-1-sulfonate (CID 20749602) is 2-hydroxy-4,4-dimethylpentane-1-sulfonate.
What is the SMILES notation for 2-hydroxy-4,4-dimethylpentane-1-sulfonate?
The canonical SMILES for 2-hydroxy-4,4-dimethylpentane-1-sulfonate is CC(C)(C)CC(O)CS(=O)(=O)[O-].
What is the InChIKey of 2-hydroxy-4,4-dimethylpentane-1-sulfonate?
The InChIKey is BJUUGGIREVLSGJ-UHFFFAOYSA-M. The full InChI is InChI=1S/C7H16O4S/c1-7(2,3)4-6(8)5-12(9,10)11/h6,8H,4-5H2,1-3H3,(H,9,10,11)/p-1.
What are the key properties of 2-hydroxy-4,4-dimethylpentane-1-sulfonate?
2-hydroxy-4,4-dimethylpentane-1-sulfonate has a molecular weight of 195.26 g/mol, XLogP of 0.33, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxy-4,4-dimethylpentane-1-sulfonate is sourced from PubChem (CID 20749602), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).