C41H32F4O4 — CID 20749751
2-(3,5-difluorophenyl)-6-[2-[3-[2-[3-(3,5-difluorophenyl)-2-hydroxy-5-methylphenyl]phenoxy]propoxy]phenyl]-4-methylphenol (PubChem CID 20749751) has the molecular formula C41H32F4O4 and a molecular weight of 664.70 g/mol. Its IUPAC name is 2-(3,5-difluorophenyl)-6-[2-[3-[2-[3-(3,5-difluorophenyl)-2-hydroxy-5-methylphenyl]phenoxy]propoxy]phenyl]-4-methylphenol.
| Compound Name | 2-(3,5-difluorophenyl)-6-[2-[3-[2-[3-(3,5-difluorophenyl)-2-hydroxy-5-methylphenyl]phenoxy]propoxy]phenyl]-4-methylphenol |
|---|---|
| PubChem CID | 20749751 |
| Molecular Formula | C41H32F4O4 |
| Molecular Weight | 664.70 g/mol |
| Exact Mass | 664.22 |
| IUPAC Name | 2-(3,5-difluorophenyl)-6-[2-[3-[2-[3-(3,5-difluorophenyl)-2-hydroxy-5-methylphenyl]phenoxy]propoxy]phenyl]-4-methylphenol |
| SMILES | Cc1cc(-c2cc(F)cc(F)c2)c(O)c(-c2ccccc2OCCCOc2ccccc2-c2cc(C)cc(-c3cc(F)cc(F)c3)c2O)c1 |
| InChI | InChI=1S/C41H32F4O4/c1-24-14-34(26-18-28(42)22-29(43)19-26)40(46)36(16-24)32-8-3-5-10-38(32)48-12-7-13-49-39-11-6-4-9-33(39)37-17-25(2)15-35(41(37)47)27-20-30(44)23-31(45)21-27/h3-6,8-11,14-23,46-47H,7,12-13H2,1-2H3 |
| InChIKey | JJLYRUZRJPXQBQ-UHFFFAOYSA-N |
| XLogP | 10.79 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 664.70 |
| LogP ≤ 5 | 10.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|