C42H34F4O4 — CID 20749752
2-(3,5-difluorophenyl)-6-[2-[4-[2-[3-(3,5-difluorophenyl)-2-hydroxy-5-methylphenyl]phenoxy]butoxy]phenyl]-4-methylphenol (PubChem CID 20749752) has the molecular formula C42H34F4O4 and a molecular weight of 678.72 g/mol. Its IUPAC name is 2-(3,5-difluorophenyl)-6-[2-[4-[2-[3-(3,5-difluorophenyl)-2-hydroxy-5-methylphenyl]phenoxy]butoxy]phenyl]-4-methylphenol.
| Compound Name | 2-(3,5-difluorophenyl)-6-[2-[4-[2-[3-(3,5-difluorophenyl)-2-hydroxy-5-methylphenyl]phenoxy]butoxy]phenyl]-4-methylphenol |
|---|---|
| PubChem CID | 20749752 |
| Molecular Formula | C42H34F4O4 |
| Molecular Weight | 678.72 g/mol |
| Exact Mass | 678.24 |
| IUPAC Name | 2-(3,5-difluorophenyl)-6-[2-[4-[2-[3-(3,5-difluorophenyl)-2-hydroxy-5-methylphenyl]phenoxy]butoxy]phenyl]-4-methylphenol |
| SMILES | Cc1cc(-c2cc(F)cc(F)c2)c(O)c(-c2ccccc2OCCCCOc2ccccc2-c2cc(C)cc(-c3cc(F)cc(F)c3)c2O)c1 |
| InChI | InChI=1S/C42H34F4O4/c1-25-15-35(27-19-29(43)23-30(44)20-27)41(47)37(17-25)33-9-3-5-11-39(33)49-13-7-8-14-50-40-12-6-4-10-34(40)38-18-26(2)16-36(42(38)48)28-21-31(45)24-32(46)22-28/h3-6,9-12,15-24,47-48H,7-8,13-14H2,1-2H3 |
| InChIKey | GXZAENGYUQUMGJ-UHFFFAOYSA-N |
| XLogP | 11.18 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 678.72 |
| LogP ≤ 5 | 11.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|