C55H62F2O4 — CID 20749757
2-(3,5-ditert-butylphenyl)-6-[2-[3-[2-[3-(3,5-ditert-butylphenyl)-5-fluoro-2-hydroxyphenyl]phenoxy]propoxy]phenyl]-4-fluorophenol (PubChem CID 20749757) has the molecular formula C55H62F2O4 and a molecular weight of 825.09 g/mol. Its IUPAC name is 2-(3,5-ditert-butylphenyl)-6-[2-[3-[2-[3-(3,5-ditert-butylphenyl)-5-fluoro-2-hydroxyphenyl]phenoxy]propoxy]phenyl]-4-fluorophenol.
| Compound Name | 2-(3,5-ditert-butylphenyl)-6-[2-[3-[2-[3-(3,5-ditert-butylphenyl)-5-fluoro-2-hydroxyphenyl]phenoxy]propoxy]phenyl]-4-fluorophenol |
|---|---|
| PubChem CID | 20749757 |
| Molecular Formula | C55H62F2O4 |
| Molecular Weight | 825.09 g/mol |
| Exact Mass | 824.46 |
| IUPAC Name | 2-(3,5-ditert-butylphenyl)-6-[2-[3-[2-[3-(3,5-ditert-butylphenyl)-5-fluoro-2-hydroxyphenyl]phenoxy]propoxy]phenyl]-4-fluorophenol |
| SMILES | CC(C)(C)c1cc(-c2cc(F)cc(-c3ccccc3OCCCOc3ccccc3-c3cc(F)cc(-c4cc(C(C)(C)C)cc(C(C)(C)C)c4)c3O)c2O)cc(C(C)(C)C)c1 |
| InChI | InChI=1S/C55H62F2O4/c1-52(2,3)36-24-34(25-37(28-36)53(4,5)6)44-30-40(56)32-46(50(44)58)42-18-13-15-20-48(42)60-22-17-23-61-49-21-16-14-19-43(49)47-33-41(57)31-45(51(47)59)35-26-38(54(7,8)9)29-39(27-35)55(10,11)12/h13-16,18-21,24-33,58-59H,17,22-23H2,1-12H3 |
| InChIKey | MXAUMQWQGLROQB-UHFFFAOYSA-N |
| XLogP | 15.08 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 825.09 |
| LogP ≤ 5 | 15.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|