About 1-(azocan-1-yl)-2-(tert-butylamino)-4,4-dimethylpentan-3-one
1-(azocan-1-yl)-2-(tert-butylamino)-4,4-dimethylpentan-3-one (PubChem CID 20750263) has the molecular formula C18H36N2O
and a molecular weight of 296.50 g/mol. Its IUPAC name is 1-(azocan-1-yl)-2-(tert-butylamino)-4,4-dimethylpentan-3-one.
Molecular Properties
| Compound Name | 1-(azocan-1-yl)-2-(tert-butylamino)-4,4-dimethylpentan-3-one |
| PubChem CID | 20750263 |
| Molecular Formula | C18H36N2O |
| Molecular Weight | 296.50 g/mol |
| Exact Mass | 296.28 |
| IUPAC Name | 1-(azocan-1-yl)-2-(tert-butylamino)-4,4-dimethylpentan-3-one |
| SMILES | CC(C)(C)NC(CN1CCCCCCC1)C(=O)C(C)(C)C |
| InChI | InChI=1S/C18H36N2O/c1-17(2,3)16(21)15(19-18(4,5)6)14-20-12-10-8-7-9-11-13-20/h15,19H,7-14H2,1-6H3 |
| InChIKey | JUTQCTNFBBWBGM-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.50 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-(azocan-1-yl)-2-(tert-butylamino)-4,4-dimethylpentan-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(azocan-1-yl)-2-(tert-butylamino)-4,4-dimethylpentan-3-one?
The IUPAC name of 1-(azocan-1-yl)-2-(tert-butylamino)-4,4-dimethylpentan-3-one (CID 20750263) is 1-(azocan-1-yl)-2-(tert-butylamino)-4,4-dimethylpentan-3-one.
What is the SMILES notation for 1-(azocan-1-yl)-2-(tert-butylamino)-4,4-dimethylpentan-3-one?
The canonical SMILES for 1-(azocan-1-yl)-2-(tert-butylamino)-4,4-dimethylpentan-3-one is CC(C)(C)NC(CN1CCCCCCC1)C(=O)C(C)(C)C.
What is the InChIKey of 1-(azocan-1-yl)-2-(tert-butylamino)-4,4-dimethylpentan-3-one?
The InChIKey is JUTQCTNFBBWBGM-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H36N2O/c1-17(2,3)16(21)15(19-18(4,5)6)14-20-12-10-8-7-9-11-13-20/h15,19H,7-14H2,1-6H3.
What are the key properties of 1-(azocan-1-yl)-2-(tert-butylamino)-4,4-dimethylpentan-3-one?
1-(azocan-1-yl)-2-(tert-butylamino)-4,4-dimethylpentan-3-one has a molecular weight of 296.50 g/mol, XLogP of 3.62, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(azocan-1-yl)-2-(tert-butylamino)-4,4-dimethylpentan-3-one is sourced from PubChem (CID 20750263), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).