About 4-(tert-butylamino)-2,2,6-trimethyloctan-3-one
4-(tert-butylamino)-2,2,6-trimethyloctan-3-one (PubChem CID 20750290) has the molecular formula C15H31NO
and a molecular weight of 241.42 g/mol. Its IUPAC name is 4-(tert-butylamino)-2,2,6-trimethyloctan-3-one.
Molecular Properties
| Compound Name | 4-(tert-butylamino)-2,2,6-trimethyloctan-3-one |
| PubChem CID | 20750290 |
| Molecular Formula | C15H31NO |
| Molecular Weight | 241.42 g/mol |
| Exact Mass | 241.24 |
| IUPAC Name | 4-(tert-butylamino)-2,2,6-trimethyloctan-3-one |
| SMILES | CCC(C)CC(NC(C)(C)C)C(=O)C(C)(C)C |
| InChI | InChI=1S/C15H31NO/c1-9-11(2)10-12(16-15(6,7)8)13(17)14(3,4)5/h11-12,16H,9-10H2,1-8H3 |
| InChIKey | AAWMAAMMBPWZCZ-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.42 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-(tert-butylamino)-2,2,6-trimethyloctan-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(tert-butylamino)-2,2,6-trimethyloctan-3-one?
The IUPAC name of 4-(tert-butylamino)-2,2,6-trimethyloctan-3-one (CID 20750290) is 4-(tert-butylamino)-2,2,6-trimethyloctan-3-one.
What is the SMILES notation for 4-(tert-butylamino)-2,2,6-trimethyloctan-3-one?
The canonical SMILES for 4-(tert-butylamino)-2,2,6-trimethyloctan-3-one is CCC(C)CC(NC(C)(C)C)C(=O)C(C)(C)C.
What is the InChIKey of 4-(tert-butylamino)-2,2,6-trimethyloctan-3-one?
The InChIKey is AAWMAAMMBPWZCZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H31NO/c1-9-11(2)10-12(16-15(6,7)8)13(17)14(3,4)5/h11-12,16H,9-10H2,1-8H3.
What are the key properties of 4-(tert-butylamino)-2,2,6-trimethyloctan-3-one?
4-(tert-butylamino)-2,2,6-trimethyloctan-3-one has a molecular weight of 241.42 g/mol, XLogP of 3.79, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(tert-butylamino)-2,2,6-trimethyloctan-3-one is sourced from PubChem (CID 20750290), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).