About 3-(tert-butylamino)-5,5-dimethyl-1-pyrrolidin-1-ylhexane-1,4-dione
3-(tert-butylamino)-5,5-dimethyl-1-pyrrolidin-1-ylhexane-1,4-dione (PubChem CID 20750375) has the molecular formula C16H30N2O2
and a molecular weight of 282.43 g/mol. Its IUPAC name is 3-(tert-butylamino)-5,5-dimethyl-1-pyrrolidin-1-ylhexane-1,4-dione.
Molecular Properties
| Compound Name | 3-(tert-butylamino)-5,5-dimethyl-1-pyrrolidin-1-ylhexane-1,4-dione |
| PubChem CID | 20750375 |
| Molecular Formula | C16H30N2O2 |
| Molecular Weight | 282.43 g/mol |
| Exact Mass | 282.23 |
| IUPAC Name | 3-(tert-butylamino)-5,5-dimethyl-1-pyrrolidin-1-ylhexane-1,4-dione |
| SMILES | CC(C)(C)NC(CC(=O)N1CCCC1)C(=O)C(C)(C)C |
| InChI | InChI=1S/C16H30N2O2/c1-15(2,3)14(20)12(17-16(4,5)6)11-13(19)18-9-7-8-10-18/h12,17H,7-11H2,1-6H3 |
| InChIKey | SJUJGHACRQQZDK-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.43 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-(tert-butylamino)-5,5-dimethyl-1-pyrrolidin-1-ylhexane-1,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(tert-butylamino)-5,5-dimethyl-1-pyrrolidin-1-ylhexane-1,4-dione?
The IUPAC name of 3-(tert-butylamino)-5,5-dimethyl-1-pyrrolidin-1-ylhexane-1,4-dione (CID 20750375) is 3-(tert-butylamino)-5,5-dimethyl-1-pyrrolidin-1-ylhexane-1,4-dione.
What is the SMILES notation for 3-(tert-butylamino)-5,5-dimethyl-1-pyrrolidin-1-ylhexane-1,4-dione?
The canonical SMILES for 3-(tert-butylamino)-5,5-dimethyl-1-pyrrolidin-1-ylhexane-1,4-dione is CC(C)(C)NC(CC(=O)N1CCCC1)C(=O)C(C)(C)C.
What is the InChIKey of 3-(tert-butylamino)-5,5-dimethyl-1-pyrrolidin-1-ylhexane-1,4-dione?
The InChIKey is SJUJGHACRQQZDK-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H30N2O2/c1-15(2,3)14(20)12(17-16(4,5)6)11-13(19)18-9-7-8-10-18/h12,17H,7-11H2,1-6H3.
What are the key properties of 3-(tert-butylamino)-5,5-dimethyl-1-pyrrolidin-1-ylhexane-1,4-dione?
3-(tert-butylamino)-5,5-dimethyl-1-pyrrolidin-1-ylhexane-1,4-dione has a molecular weight of 282.43 g/mol, XLogP of 2.37, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(tert-butylamino)-5,5-dimethyl-1-pyrrolidin-1-ylhexane-1,4-dione is sourced from PubChem (CID 20750375), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).