About N-[oxo-(trifluoromethyl)-(trifluoromethylsulfonylamino)-λ6-sulfanylidene]prop-2-ene-1-sulfonamide
N-[oxo-(trifluoromethyl)-(trifluoromethylsulfonylamino)-λ6-sulfanylidene]prop-2-ene-1-sulfonamide (PubChem CID 20750478) has the molecular formula C5H6F6N2O5S3
and a molecular weight of 384.30 g/mol. Its IUPAC name is N-[oxo-(trifluoromethyl)-(trifluoromethylsulfonylamino)-λ6-sulfanylidene]prop-2-ene-1-sulfonamide.
Molecular Properties
| Compound Name | N-[oxo-(trifluoromethyl)-(trifluoromethylsulfonylamino)-λ6-sulfanylidene]prop-2-ene-1-sulfonamide |
| PubChem CID | 20750478 |
| Molecular Formula | C5H6F6N2O5S3 |
| Molecular Weight | 384.30 g/mol |
| Exact Mass | 383.93 |
| IUPAC Name | N-[oxo-(trifluoromethyl)-(trifluoromethylsulfonylamino)-λ6-sulfanylidene]prop-2-ene-1-sulfonamide |
| SMILES | C=CCS(=O)(=O)N=S(=O)(NS(=O)(=O)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C5H6F6N2O5S3/c1-2-3-19(14,15)12-20(16,4(6,7)8)13-21(17,18)5(9,10)11/h2H,1,3H2,(H,12,13,16) |
| InChIKey | ZMSNLNMOMZIRTM-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 109.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 384.30 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N-[oxo-(trifluoromethyl)-(trifluoromethylsulfonylamino)-λ6-sulfanylidene]prop-2-ene-1-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[oxo-(trifluoromethyl)-(trifluoromethylsulfonylamino)-λ6-sulfanylidene]prop-2-ene-1-sulfonamide?
The IUPAC name of N-[oxo-(trifluoromethyl)-(trifluoromethylsulfonylamino)-λ6-sulfanylidene]prop-2-ene-1-sulfonamide (CID 20750478) is N-[oxo-(trifluoromethyl)-(trifluoromethylsulfonylamino)-λ6-sulfanylidene]prop-2-ene-1-sulfonamide.
What is the SMILES notation for N-[oxo-(trifluoromethyl)-(trifluoromethylsulfonylamino)-λ6-sulfanylidene]prop-2-ene-1-sulfonamide?
The canonical SMILES for N-[oxo-(trifluoromethyl)-(trifluoromethylsulfonylamino)-λ6-sulfanylidene]prop-2-ene-1-sulfonamide is C=CCS(=O)(=O)N=S(=O)(NS(=O)(=O)C(F)(F)F)C(F)(F)F.
What is the InChIKey of N-[oxo-(trifluoromethyl)-(trifluoromethylsulfonylamino)-λ6-sulfanylidene]prop-2-ene-1-sulfonamide?
The InChIKey is ZMSNLNMOMZIRTM-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H6F6N2O5S3/c1-2-3-19(14,15)12-20(16,4(6,7)8)13-21(17,18)5(9,10)11/h2H,1,3H2,(H,12,13,16).
What are the key properties of N-[oxo-(trifluoromethyl)-(trifluoromethylsulfonylamino)-λ6-sulfanylidene]prop-2-ene-1-sulfonamide?
N-[oxo-(trifluoromethyl)-(trifluoromethylsulfonylamino)-λ6-sulfanylidene]prop-2-ene-1-sulfonamide has a molecular weight of 384.30 g/mol, XLogP of 0.84, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[oxo-(trifluoromethyl)-(trifluoromethylsulfonylamino)-λ6-sulfanylidene]prop-2-ene-1-sulfonamide is sourced from PubChem (CID 20750478), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).