C17H12O6 — CID 20750593
spiro[9,13-dioxatricyclo[13.4.0.02,7]nonadeca-1(19),2,4,6,15,17-hexaene-11,3'-dioxirane]-8,14-dione (PubChem CID 20750593) has the molecular formula C17H12O6 and a molecular weight of 312.28 g/mol. Its IUPAC name is spiro[9,13-dioxatricyclo[13.4.0.02,7]nonadeca-1(19),2,4,6,15,17-hexaene-11,3'-dioxirane]-8,14-dione.
| Compound Name | spiro[9,13-dioxatricyclo[13.4.0.02,7]nonadeca-1(19),2,4,6,15,17-hexaene-11,3'-dioxirane]-8,14-dione |
|---|---|
| PubChem CID | 20750593 |
| Molecular Formula | C17H12O6 |
| Molecular Weight | 312.28 g/mol |
| Exact Mass | 312.06 |
| IUPAC Name | spiro[9,13-dioxatricyclo[13.4.0.02,7]nonadeca-1(19),2,4,6,15,17-hexaene-11,3'-dioxirane]-8,14-dione |
| SMILES | O=C1OCC2(COC(=O)c3ccccc3-c3ccccc31)OO2 |
| InChI | InChI=1S/C17H12O6/c18-15-13-7-3-1-5-11(13)12-6-2-4-8-14(12)16(19)21-10-17(9-20-15)22-23-17/h1-8H,9-10H2 |
| InChIKey | AYSQSHPLKMJBRV-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 77.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.28 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|