1-ethyltriazole-4-carboxylic acid

C5H7N3O2 — CID 20750680

IUPAC1-ethyltriazole-4-carboxylic acid
SMILESCCn1cc(C(=O)O)nn1
InChIInChI=1S/C5H7N3O2/c1-2-8-3-4(5(9)10)6-7-8/h3H,2H2,1H3,(H,9,10)
InChIKeyZOIAVKVPWOFRSG-UHFFFAOYSA-N
MW141.13 g/mol
LogP-0.00
Rot. Bonds2

About 1-ethyltriazole-4-carboxylic acid

1-ethyltriazole-4-carboxylic acid (PubChem CID 20750680) has the molecular formula C5H7N3O2 and a molecular weight of 141.13 g/mol. Its IUPAC name is 1-ethyltriazole-4-carboxylic acid.

Molecular Properties

Compound Name1-ethyltriazole-4-carboxylic acid
PubChem CID20750680
Molecular FormulaC5H7N3O2
Molecular Weight141.13 g/mol
Exact Mass141.05
IUPAC Name1-ethyltriazole-4-carboxylic acid
SMILESCCn1cc(C(=O)O)nn1
InChIInChI=1S/C5H7N3O2/c1-2-8-3-4(5(9)10)6-7-8/h3H,2H2,1H3,(H,9,10)
InChIKeyZOIAVKVPWOFRSG-UHFFFAOYSA-N
XLogP-0.00
TPSA68.01 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds2
Heavy Atoms10
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500141.13
LogP ≤ 5-0.00
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze 1-ethyltriazole-4-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1-ethyltriazole-4-carboxylic acid?
The IUPAC name of 1-ethyltriazole-4-carboxylic acid (CID 20750680) is 1-ethyltriazole-4-carboxylic acid.
What is the SMILES notation for 1-ethyltriazole-4-carboxylic acid?
The canonical SMILES for 1-ethyltriazole-4-carboxylic acid is CCn1cc(C(=O)O)nn1.
What is the InChIKey of 1-ethyltriazole-4-carboxylic acid?
The InChIKey is ZOIAVKVPWOFRSG-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H7N3O2/c1-2-8-3-4(5(9)10)6-7-8/h3H,2H2,1H3,(H,9,10).
What are the key properties of 1-ethyltriazole-4-carboxylic acid?
1-ethyltriazole-4-carboxylic acid has a molecular weight of 141.13 g/mol, XLogP of -0.00, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethyltriazole-4-carboxylic acid is sourced from PubChem (CID 20750680), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).