C31H30F6O3 — CID 20750972
[4-[4-methoxy-2,3-bis(trifluoromethyl)phenyl]phenyl] 4-(4-propylcyclohexyl)benzoate (PubChem CID 20750972) has the molecular formula C31H30F6O3 and a molecular weight of 564.57 g/mol. Its IUPAC name is [4-[4-methoxy-2,3-bis(trifluoromethyl)phenyl]phenyl] 4-(4-propylcyclohexyl)benzoate.
| Compound Name | [4-[4-methoxy-2,3-bis(trifluoromethyl)phenyl]phenyl] 4-(4-propylcyclohexyl)benzoate |
|---|---|
| PubChem CID | 20750972 |
| Molecular Formula | C31H30F6O3 |
| Molecular Weight | 564.57 g/mol |
| Exact Mass | 564.21 |
| IUPAC Name | [4-[4-methoxy-2,3-bis(trifluoromethyl)phenyl]phenyl] 4-(4-propylcyclohexyl)benzoate |
| SMILES | CCCC1CCC(c2ccc(C(=O)Oc3ccc(-c4ccc(OC)c(C(F)(F)F)c4C(F)(F)F)cc3)cc2)CC1 |
| InChI | InChI=1S/C31H30F6O3/c1-3-4-19-5-7-20(8-6-19)21-9-11-23(12-10-21)29(38)40-24-15-13-22(14-16-24)25-17-18-26(39-2)28(31(35,36)37)27(25)30(32,33)34/h9-20H,3-8H2,1-2H3 |
| InChIKey | GYYCTMVUCOOESM-UHFFFAOYSA-N |
| XLogP | 9.69 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.57 |
| LogP ≤ 5 | 9.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|