C9H7F9O4 — CID 20751083
[2,2-difluoro-2-[1,1,2,2-tetrafluoro-2-(trifluoromethoxy)ethoxy]ethyl] 2-methylprop-2-enoate (PubChem CID 20751083) has the molecular formula C9H7F9O4 and a molecular weight of 350.13 g/mol. Its IUPAC name is [2,2-difluoro-2-[1,1,2,2-tetrafluoro-2-(trifluoromethoxy)ethoxy]ethyl] 2-methylprop-2-enoate.
| Compound Name | [2,2-difluoro-2-[1,1,2,2-tetrafluoro-2-(trifluoromethoxy)ethoxy]ethyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 20751083 |
| Molecular Formula | C9H7F9O4 |
| Molecular Weight | 350.13 g/mol |
| Exact Mass | 350.02 |
| IUPAC Name | [2,2-difluoro-2-[1,1,2,2-tetrafluoro-2-(trifluoromethoxy)ethoxy]ethyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCC(F)(F)OC(F)(F)C(F)(F)OC(F)(F)F |
| InChI | InChI=1S/C9H7F9O4/c1-4(2)5(19)20-3-6(10,11)21-7(12,13)8(14,15)22-9(16,17)18/h1,3H2,2H3 |
| InChIKey | XYPAJFPAVIJIIB-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.13 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|