C33H43N5O6S — CID 20751182
(2,4,6-trimethylcyclohexyl) 2-[1-[[2-(2,4-dimethylphenoxy)acetyl]amino]propan-2-yl]-5-(1-ethylperoxyethenylsulfanyl)-6-isocyano-3H-pyrrolo[1,2-b][1,2,4]triazole-7-carboxylate (PubChem CID 20751182) has the molecular formula C33H43N5O6S and a molecular weight of 637.80 g/mol. Its IUPAC name is (2,4,6-trimethylcyclohexyl) 2-[1-[[2-(2,4-dimethylphenoxy)acetyl]amino]propan-2-yl]-5-(1-ethylperoxyethenylsulfanyl)-6-isocyano-3H-pyrrolo[1,2-b][1,2,4]triazole-7-carboxylate.
| Compound Name | (2,4,6-trimethylcyclohexyl) 2-[1-[[2-(2,4-dimethylphenoxy)acetyl]amino]propan-2-yl]-5-(1-ethylperoxyethenylsulfanyl)-6-isocyano-3H-pyrrolo[1,2-b][1,2,4]triazole-7-carboxylate |
|---|---|
| PubChem CID | 20751182 |
| Molecular Formula | C33H43N5O6S |
| Molecular Weight | 637.80 g/mol |
| Exact Mass | 637.29 |
| IUPAC Name | (2,4,6-trimethylcyclohexyl) 2-[1-[[2-(2,4-dimethylphenoxy)acetyl]amino]propan-2-yl]-5-(1-ethylperoxyethenylsulfanyl)-6-isocyano-3H-pyrrolo[1,2-b][1,2,4]triazole-7-carboxylate |
| SMILES | [C-]#[N+]c1c(C(=O)OC2C(C)CC(C)CC2C)c2nc(C(C)CNC(=O)COc3ccc(C)cc3C)[nH]n2c1SC(=C)OOCC |
| InChI | InChI=1S/C33H43N5O6S/c1-10-42-44-24(8)45-32-28(34-9)27(33(40)43-29-21(5)14-19(3)15-22(29)6)31-36-30(37-38(31)32)23(7)16-35-26(39)17-41-25-12-11-18(2)13-20(25)4/h11-13,19,21-23,29H,8,10,14-17H2,1-7H3,(H,35,39)(H,36,37) |
| InChIKey | FDNMFIIYHYDHFB-UHFFFAOYSA-N |
| XLogP | 6.89 |
| TPSA | 120.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.80 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|