C26H33NO4 — CID 20751580
5-(5,5,8,8-tetramethyl-3-pentyl-6,7-dihydronaphthalene-2-carbonyl)oxypyridine-2-carboxylic acid (PubChem CID 20751580) has the molecular formula C26H33NO4 and a molecular weight of 423.55 g/mol. Its IUPAC name is 5-(5,5,8,8-tetramethyl-3-pentyl-6,7-dihydronaphthalene-2-carbonyl)oxypyridine-2-carboxylic acid.
| Compound Name | 5-(5,5,8,8-tetramethyl-3-pentyl-6,7-dihydronaphthalene-2-carbonyl)oxypyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 20751580 |
| Molecular Formula | C26H33NO4 |
| Molecular Weight | 423.55 g/mol |
| Exact Mass | 423.24 |
| IUPAC Name | 5-(5,5,8,8-tetramethyl-3-pentyl-6,7-dihydronaphthalene-2-carbonyl)oxypyridine-2-carboxylic acid |
| SMILES | CCCCCc1cc2c(cc1C(=O)Oc1ccc(C(=O)O)nc1)C(C)(C)CCC2(C)C |
| InChI | InChI=1S/C26H33NO4/c1-6-7-8-9-17-14-20-21(26(4,5)13-12-25(20,2)3)15-19(17)24(30)31-18-10-11-22(23(28)29)27-16-18/h10-11,14-16H,6-9,12-13H2,1-5H3,(H,28,29) |
| InChIKey | CJRRNVNKWIIGFP-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 76.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.55 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|