C22H20F6N2S2 — CID 20751852
2-N,3-N-bis[2,4-dimethyl-6-(trifluoromethyl)phenyl]-1,4-dithiane-2,3-diimine (PubChem CID 20751852) has the molecular formula C22H20F6N2S2 and a molecular weight of 490.54 g/mol. Its IUPAC name is 2-N,3-N-bis[2,4-dimethyl-6-(trifluoromethyl)phenyl]-1,4-dithiane-2,3-diimine.
| Compound Name | 2-N,3-N-bis[2,4-dimethyl-6-(trifluoromethyl)phenyl]-1,4-dithiane-2,3-diimine |
|---|---|
| PubChem CID | 20751852 |
| Molecular Formula | C22H20F6N2S2 |
| Molecular Weight | 490.54 g/mol |
| Exact Mass | 490.10 |
| IUPAC Name | 2-N,3-N-bis[2,4-dimethyl-6-(trifluoromethyl)phenyl]-1,4-dithiane-2,3-diimine |
| SMILES | Cc1cc(C)c(/N=C2\SCCS\C2=N/c2c(C)cc(C)cc2C(F)(F)F)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C22H20F6N2S2/c1-11-7-13(3)17(15(9-11)21(23,24)25)29-19-20(32-6-5-31-19)30-18-14(4)8-12(2)10-16(18)22(26,27)28/h7-10H,5-6H2,1-4H3/b29-19-,30-20- |
| InChIKey | NCVYTZZOGOWBIU-NAZWXXJZSA-N |
| XLogP | 8.20 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.54 |
| LogP ≤ 5 | 8.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|