About 9,9-bis[2-(2-ethoxyethoxy)ethyl]-2,7-dimethylfluorene
9,9-bis[2-(2-ethoxyethoxy)ethyl]-2,7-dimethylfluorene (PubChem CID 20751971) has the molecular formula C27H38O4
and a molecular weight of 426.60 g/mol. Its IUPAC name is 9,9-bis[2-(2-ethoxyethoxy)ethyl]-2,7-dimethylfluorene.
Molecular Properties
| Compound Name | 9,9-bis[2-(2-ethoxyethoxy)ethyl]-2,7-dimethylfluorene |
| PubChem CID | 20751971 |
| Molecular Formula | C27H38O4 |
| Molecular Weight | 426.60 g/mol |
| Exact Mass | 426.28 |
| IUPAC Name | 9,9-bis[2-(2-ethoxyethoxy)ethyl]-2,7-dimethylfluorene |
| SMILES | CCOCCOCCC1(CCOCCOCC)c2cc(C)ccc2-c2ccc(C)cc21 |
| InChI | InChI=1S/C27H38O4/c1-5-28-15-17-30-13-11-27(12-14-31-18-16-29-6-2)25-19-21(3)7-9-23(25)24-10-8-22(4)20-26(24)27/h7-10,19-20H,5-6,11-18H2,1-4H3 |
| InChIKey | LBMSCTZTPKUHQR-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 426.60 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 9,9-bis[2-(2-ethoxyethoxy)ethyl]-2,7-dimethylfluorene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9,9-bis[2-(2-ethoxyethoxy)ethyl]-2,7-dimethylfluorene?
The IUPAC name of 9,9-bis[2-(2-ethoxyethoxy)ethyl]-2,7-dimethylfluorene (CID 20751971) is 9,9-bis[2-(2-ethoxyethoxy)ethyl]-2,7-dimethylfluorene.
What is the SMILES notation for 9,9-bis[2-(2-ethoxyethoxy)ethyl]-2,7-dimethylfluorene?
The canonical SMILES for 9,9-bis[2-(2-ethoxyethoxy)ethyl]-2,7-dimethylfluorene is CCOCCOCCC1(CCOCCOCC)c2cc(C)ccc2-c2ccc(C)cc21.
What is the InChIKey of 9,9-bis[2-(2-ethoxyethoxy)ethyl]-2,7-dimethylfluorene?
The InChIKey is LBMSCTZTPKUHQR-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H38O4/c1-5-28-15-17-30-13-11-27(12-14-31-18-16-29-6-2)25-19-21(3)7-9-23(25)24-10-8-22(4)20-26(24)27/h7-10,19-20H,5-6,11-18H2,1-4H3.
What are the key properties of 9,9-bis[2-(2-ethoxyethoxy)ethyl]-2,7-dimethylfluorene?
9,9-bis[2-(2-ethoxyethoxy)ethyl]-2,7-dimethylfluorene has a molecular weight of 426.60 g/mol, XLogP of 5.46, 14 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 9,9-bis[2-(2-ethoxyethoxy)ethyl]-2,7-dimethylfluorene is sourced from PubChem (CID 20751971), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).