About 1-N,2-N-bis(2-ethylhexyl)cyclopentane-1,2-dicarboxamide
1-N,2-N-bis(2-ethylhexyl)cyclopentane-1,2-dicarboxamide (PubChem CID 20752259) has the molecular formula C23H44N2O2
and a molecular weight of 380.62 g/mol. Its IUPAC name is 1-N,2-N-bis(2-ethylhexyl)cyclopentane-1,2-dicarboxamide.
Molecular Properties
| Compound Name | 1-N,2-N-bis(2-ethylhexyl)cyclopentane-1,2-dicarboxamide |
| PubChem CID | 20752259 |
| Molecular Formula | C23H44N2O2 |
| Molecular Weight | 380.62 g/mol |
| Exact Mass | 380.34 |
| IUPAC Name | 1-N,2-N-bis(2-ethylhexyl)cyclopentane-1,2-dicarboxamide |
| SMILES | CCCCC(CC)CNC(=O)C1CCCC1C(=O)NCC(CC)CCCC |
| InChI | InChI=1S/C23H44N2O2/c1-5-9-12-18(7-3)16-24-22(26)20-14-11-15-21(20)23(27)25-17-19(8-4)13-10-6-2/h18-21H,5-17H2,1-4H3,(H,24,26)(H,25,27) |
| InChIKey | NHDDXMAAABXOTG-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 380.62 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-N,2-N-bis(2-ethylhexyl)cyclopentane-1,2-dicarboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-N,2-N-bis(2-ethylhexyl)cyclopentane-1,2-dicarboxamide?
The IUPAC name of 1-N,2-N-bis(2-ethylhexyl)cyclopentane-1,2-dicarboxamide (CID 20752259) is 1-N,2-N-bis(2-ethylhexyl)cyclopentane-1,2-dicarboxamide.
What is the SMILES notation for 1-N,2-N-bis(2-ethylhexyl)cyclopentane-1,2-dicarboxamide?
The canonical SMILES for 1-N,2-N-bis(2-ethylhexyl)cyclopentane-1,2-dicarboxamide is CCCCC(CC)CNC(=O)C1CCCC1C(=O)NCC(CC)CCCC.
What is the InChIKey of 1-N,2-N-bis(2-ethylhexyl)cyclopentane-1,2-dicarboxamide?
The InChIKey is NHDDXMAAABXOTG-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H44N2O2/c1-5-9-12-18(7-3)16-24-22(26)20-14-11-15-21(20)23(27)25-17-19(8-4)13-10-6-2/h18-21H,5-17H2,1-4H3,(H,24,26)(H,25,27).
What are the key properties of 1-N,2-N-bis(2-ethylhexyl)cyclopentane-1,2-dicarboxamide?
1-N,2-N-bis(2-ethylhexyl)cyclopentane-1,2-dicarboxamide has a molecular weight of 380.62 g/mol, XLogP of 5.07, 14 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-N,2-N-bis(2-ethylhexyl)cyclopentane-1,2-dicarboxamide is sourced from PubChem (CID 20752259), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).