C24H36O9Si — CID 20753310
methyl (2R,3S,4R,5R)-5,6-diacetyloxy-3-[tert-butyl(dimethyl)silyl]oxy-4-phenylmethoxyoxane-2-carboxylate (PubChem CID 20753310) has the molecular formula C24H36O9Si and a molecular weight of 496.63 g/mol. Its IUPAC name is methyl (2R,3S,4R,5R)-5,6-diacetyloxy-3-[tert-butyl(dimethyl)silyl]oxy-4-phenylmethoxyoxane-2-carboxylate.
| Compound Name | methyl (2R,3S,4R,5R)-5,6-diacetyloxy-3-[tert-butyl(dimethyl)silyl]oxy-4-phenylmethoxyoxane-2-carboxylate |
|---|---|
| PubChem CID | 20753310 |
| Molecular Formula | C24H36O9Si |
| Molecular Weight | 496.63 g/mol |
| Exact Mass | 496.21 |
| IUPAC Name | methyl (2R,3S,4R,5R)-5,6-diacetyloxy-3-[tert-butyl(dimethyl)silyl]oxy-4-phenylmethoxyoxane-2-carboxylate |
| SMILES | COC(=O)[C@@H]1OC(OC(C)=O)[C@H](OC(C)=O)[C@@H](OCc2ccccc2)[C@@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C24H36O9Si/c1-15(25)30-21-18(29-14-17-12-10-9-11-13-17)19(33-34(7,8)24(3,4)5)20(22(27)28-6)32-23(21)31-16(2)26/h9-13,18-21,23H,14H2,1-8H3/t18-,19-,20+,21+,23?/m0/s1 |
| InChIKey | IPLUDQWLWVEBEY-JZKMLYSCSA-N |
| XLogP | 3.35 |
| TPSA | 106.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.63 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|