C28H37Cl3N4O5Si — CID 20753331
[(3R,4R,5S,6R)-3-azido-5-[tert-butyl(dimethyl)silyl]oxy-4-phenylmethoxy-6-(phenylmethoxymethyl)oxan-2-yl] 2,2,2-trichloroethanimidate (PubChem CID 20753331) has the molecular formula C28H37Cl3N4O5Si and a molecular weight of 644.07 g/mol. Its IUPAC name is [(3R,4R,5S,6R)-3-azido-5-[tert-butyl(dimethyl)silyl]oxy-4-phenylmethoxy-6-(phenylmethoxymethyl)oxan-2-yl] 2,2,2-trichloroethanimidate.
| Compound Name | [(3R,4R,5S,6R)-3-azido-5-[tert-butyl(dimethyl)silyl]oxy-4-phenylmethoxy-6-(phenylmethoxymethyl)oxan-2-yl] 2,2,2-trichloroethanimidate |
|---|---|
| PubChem CID | 20753331 |
| Molecular Formula | C28H37Cl3N4O5Si |
| Molecular Weight | 644.07 g/mol |
| Exact Mass | 642.16 |
| IUPAC Name | [(3R,4R,5S,6R)-3-azido-5-[tert-butyl(dimethyl)silyl]oxy-4-phenylmethoxy-6-(phenylmethoxymethyl)oxan-2-yl] 2,2,2-trichloroethanimidate |
| SMILES | [H]/N=C(/OC1O[C@H](COCc2ccccc2)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](OCc2ccccc2)[C@H]1N=[N+]=[N-])C(Cl)(Cl)Cl |
| InChI | InChI=1S/C28H37Cl3N4O5Si/c1-27(2,3)41(4,5)40-23-21(18-36-16-19-12-8-6-9-13-19)38-25(39-26(32)28(29,30)31)22(34-35-33)24(23)37-17-20-14-10-7-11-15-20/h6-15,21-25,32H,16-18H2,1-5H3/b32-26+/t21-,22-,23-,24-,25?/m1/s1 |
| InChIKey | QEKORDJWMQGGPK-XTSHULFVSA-N |
| XLogP | 7.95 |
| TPSA | 118.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.07 |
| LogP ≤ 5 | 7.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|