C28H39N3O6Si — CID 20753336
[(2R,3S,4R,5R,6S)-5-azido-6-[tert-butyl(dimethyl)silyl]oxy-3,4-bis(phenylmethoxy)oxan-2-yl]methyl acetate (PubChem CID 20753336) has the molecular formula C28H39N3O6Si and a molecular weight of 541.72 g/mol. Its IUPAC name is [(2R,3S,4R,5R,6S)-5-azido-6-[tert-butyl(dimethyl)silyl]oxy-3,4-bis(phenylmethoxy)oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3S,4R,5R,6S)-5-azido-6-[tert-butyl(dimethyl)silyl]oxy-3,4-bis(phenylmethoxy)oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 20753336 |
| Molecular Formula | C28H39N3O6Si |
| Molecular Weight | 541.72 g/mol |
| Exact Mass | 541.26 |
| IUPAC Name | [(2R,3S,4R,5R,6S)-5-azido-6-[tert-butyl(dimethyl)silyl]oxy-3,4-bis(phenylmethoxy)oxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](N=[N+]=[N-])[C@@H](OCc2ccccc2)[C@@H]1OCc1ccccc1 |
| InChI | InChI=1S/C28H39N3O6Si/c1-20(32)33-19-23-25(34-17-21-13-9-7-10-14-21)26(35-18-22-15-11-8-12-16-22)24(30-31-29)27(36-23)37-38(5,6)28(2,3)4/h7-16,23-27H,17-19H2,1-6H3/t23-,24-,25-,26-,27+/m1/s1 |
| InChIKey | MNXWLCGBOXXBFI-ACFIUOAZSA-N |
| XLogP | 6.15 |
| TPSA | 111.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.72 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|