About 2-bromo-1-ethylindole
2-bromo-1-ethylindole (PubChem CID 20753566) has the molecular formula C10H10BrN
and a molecular weight of 224.10 g/mol. Its IUPAC name is 2-bromo-1-ethylindole.
Molecular Properties
| Compound Name | 2-bromo-1-ethylindole |
| PubChem CID | 20753566 |
| Molecular Formula | C10H10BrN |
| Molecular Weight | 224.10 g/mol |
| Exact Mass | 223.00 |
| IUPAC Name | 2-bromo-1-ethylindole |
| SMILES | CCn1c(Br)cc2ccccc21 |
| InChI | InChI=1S/C10H10BrN/c1-2-12-9-6-4-3-5-8(9)7-10(12)11/h3-7H,2H2,1H3 |
| InChIKey | WDQJHBSMBZZLGQ-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.10 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-bromo-1-ethylindole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromo-1-ethylindole?
The IUPAC name of 2-bromo-1-ethylindole (CID 20753566) is 2-bromo-1-ethylindole.
What is the SMILES notation for 2-bromo-1-ethylindole?
The canonical SMILES for 2-bromo-1-ethylindole is CCn1c(Br)cc2ccccc21.
What is the InChIKey of 2-bromo-1-ethylindole?
The InChIKey is WDQJHBSMBZZLGQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10BrN/c1-2-12-9-6-4-3-5-8(9)7-10(12)11/h3-7H,2H2,1H3.
What are the key properties of 2-bromo-1-ethylindole?
2-bromo-1-ethylindole has a molecular weight of 224.10 g/mol, XLogP of 3.42, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromo-1-ethylindole is sourced from PubChem (CID 20753566), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).