C7H6F6 — CID 20753605
3,3,4,4,5,5-hexafluoro-1,2-dimethylcyclopentene (PubChem CID 20753605) has the molecular formula C7H6F6 and a molecular weight of 204.11 g/mol. Its IUPAC name is 3,3,4,4,5,5-hexafluoro-1,2-dimethylcyclopentene.
| Compound Name | 3,3,4,4,5,5-hexafluoro-1,2-dimethylcyclopentene |
|---|---|
| PubChem CID | 20753605 |
| Molecular Formula | C7H6F6 |
| Molecular Weight | 204.11 g/mol |
| Exact Mass | 204.04 |
| IUPAC Name | 3,3,4,4,5,5-hexafluoro-1,2-dimethylcyclopentene |
| SMILES | CC1=C(C)C(F)(F)C(F)(F)C1(F)F |
| InChI | InChI=1S/C7H6F6/c1-3-4(2)6(10,11)7(12,13)5(3,8)9/h1-2H3 |
| InChIKey | QXJQQTBBRZMPDG-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.11 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|