C30H40O8 — CID 20754258
(2-methyl-2-adamantyl) 2-methyl-2-[4-[3-(5-methyl-2-oxo-1,3-dioxolan-4-yl)-2-bicyclo[2.2.1]heptanyl]-2,5-dioxooxolan-3-yl]propanoate (PubChem CID 20754258) has the molecular formula C30H40O8 and a molecular weight of 528.64 g/mol. Its IUPAC name is (2-methyl-2-adamantyl) 2-methyl-2-[4-[3-(5-methyl-2-oxo-1,3-dioxolan-4-yl)-2-bicyclo[2.2.1]heptanyl]-2,5-dioxooxolan-3-yl]propanoate.
| Compound Name | (2-methyl-2-adamantyl) 2-methyl-2-[4-[3-(5-methyl-2-oxo-1,3-dioxolan-4-yl)-2-bicyclo[2.2.1]heptanyl]-2,5-dioxooxolan-3-yl]propanoate |
|---|---|
| PubChem CID | 20754258 |
| Molecular Formula | C30H40O8 |
| Molecular Weight | 528.64 g/mol |
| Exact Mass | 528.27 |
| IUPAC Name | (2-methyl-2-adamantyl) 2-methyl-2-[4-[3-(5-methyl-2-oxo-1,3-dioxolan-4-yl)-2-bicyclo[2.2.1]heptanyl]-2,5-dioxooxolan-3-yl]propanoate |
| SMILES | CC1OC(=O)OC1C1C2CCC(C2)C1C1C(=O)OC(=O)C1C(C)(C)C(=O)OC1(C)C2CC3CC(C2)CC1C3 |
| InChI | InChI=1S/C30H40O8/c1-13-24(36-28(34)35-13)21-17-6-5-16(12-17)20(21)22-23(26(32)37-25(22)31)29(2,3)27(33)38-30(4)18-8-14-7-15(10-18)11-19(30)9-14/h13-24H,5-12H2,1-4H3 |
| InChIKey | PGTMCWATAAKANK-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.64 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|