C10H8F6O — CID 20754261
3,3,4-trifluoro-4-(trifluoromethoxy)tricyclo[4.2.1.02,5]non-7-ene (PubChem CID 20754261) has the molecular formula C10H8F6O and a molecular weight of 258.16 g/mol. Its IUPAC name is 3,3,4-trifluoro-4-(trifluoromethoxy)tricyclo[4.2.1.02,5]non-7-ene.
| Compound Name | 3,3,4-trifluoro-4-(trifluoromethoxy)tricyclo[4.2.1.02,5]non-7-ene |
|---|---|
| PubChem CID | 20754261 |
| Molecular Formula | C10H8F6O |
| Molecular Weight | 258.16 g/mol |
| Exact Mass | 258.05 |
| IUPAC Name | 3,3,4-trifluoro-4-(trifluoromethoxy)tricyclo[4.2.1.02,5]non-7-ene |
| SMILES | FC(F)(F)OC1(F)C2C3C=CC(C3)C2C1(F)F |
| InChI | InChI=1S/C10H8F6O/c11-8(12)6-4-1-2-5(3-4)7(6)9(8,13)17-10(14,15)16/h1-2,4-7H,3H2 |
| InChIKey | CWWSWCLFWNRXDU-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.16 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|