C15H18N3O3- — CID 20754387
(11S,16R)-3-amino-7-oxa-10,14-diazatetracyclo[8.6.1.05,17.011,16]heptadeca-1,3,5(17)-triene-14-carboxylate (PubChem CID 20754387) has the molecular formula C15H18N3O3- and a molecular weight of 288.33 g/mol. Its IUPAC name is (11S,16R)-3-amino-7-oxa-10,14-diazatetracyclo[8.6.1.05,17.011,16]heptadeca-1,3,5(17)-triene-14-carboxylate.
| Compound Name | (11S,16R)-3-amino-7-oxa-10,14-diazatetracyclo[8.6.1.05,17.011,16]heptadeca-1,3,5(17)-triene-14-carboxylate |
|---|---|
| PubChem CID | 20754387 |
| Molecular Formula | C15H18N3O3- |
| Molecular Weight | 288.33 g/mol |
| Exact Mass | 288.14 |
| IUPAC Name | (11S,16R)-3-amino-7-oxa-10,14-diazatetracyclo[8.6.1.05,17.011,16]heptadeca-1,3,5(17)-triene-14-carboxylate |
| SMILES | Nc1cc2c3c(c1)[C@@H]1CN(C(=O)[O-])CC[C@@H]1N3CCOC2 |
| InChI | InChI=1S/C15H19N3O3/c16-10-5-9-8-21-4-3-18-13-1-2-17(15(19)20)7-12(13)11(6-10)14(9)18/h5-6,12-13H,1-4,7-8,16H2,(H,19,20)/p-1/t12-,13-/m0/s1 |
| InChIKey | ZCDOHWKMIGISHQ-STQMWFEESA-M |
| XLogP | 0.12 |
| TPSA | 81.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.33 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|