C21H23F3N4O2 — CID 20754391
(11S,16R)-N-[2-(2,2,2-trifluoroethoxy)-3-pyridinyl]-7-oxa-10,14-diazatetracyclo[8.6.1.05,17.011,16]heptadeca-1,3,5(17)-trien-3-amine (PubChem CID 20754391) has the molecular formula C21H23F3N4O2 and a molecular weight of 420.44 g/mol. Its IUPAC name is (11S,16R)-N-[2-(2,2,2-trifluoroethoxy)-3-pyridinyl]-7-oxa-10,14-diazatetracyclo[8.6.1.05,17.011,16]heptadeca-1,3,5(17)-trien-3-amine.
| Compound Name | (11S,16R)-N-[2-(2,2,2-trifluoroethoxy)-3-pyridinyl]-7-oxa-10,14-diazatetracyclo[8.6.1.05,17.011,16]heptadeca-1,3,5(17)-trien-3-amine |
|---|---|
| PubChem CID | 20754391 |
| Molecular Formula | C21H23F3N4O2 |
| Molecular Weight | 420.44 g/mol |
| Exact Mass | 420.18 |
| IUPAC Name | (11S,16R)-N-[2-(2,2,2-trifluoroethoxy)-3-pyridinyl]-7-oxa-10,14-diazatetracyclo[8.6.1.05,17.011,16]heptadeca-1,3,5(17)-trien-3-amine |
| SMILES | FC(F)(F)COc1ncccc1Nc1cc2c3c(c1)[C@@H]1CNCC[C@@H]1N3CCOC2 |
| InChI | InChI=1S/C21H23F3N4O2/c22-21(23,24)12-30-20-17(2-1-4-26-20)27-14-8-13-11-29-7-6-28-18-3-5-25-10-16(18)15(9-14)19(13)28/h1-2,4,8-9,16,18,25,27H,3,5-7,10-12H2/t16-,18-/m0/s1 |
| InChIKey | LBCYMSWSGDPBPW-WMZOPIPTSA-N |
| XLogP | 3.56 |
| TPSA | 58.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.44 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |