About 2-methylpropyl (NE)-N-(1-aminoethylidene)carbamate
2-methylpropyl (NE)-N-(1-aminoethylidene)carbamate (PubChem CID 20754855) has the molecular formula C7H14N2O2
and a molecular weight of 158.20 g/mol. Its IUPAC name is 2-methylpropyl (NE)-N-(1-aminoethylidene)carbamate.
Molecular Properties
| Compound Name | 2-methylpropyl (NE)-N-(1-aminoethylidene)carbamate |
| PubChem CID | 20754855 |
| Molecular Formula | C7H14N2O2 |
| Molecular Weight | 158.20 g/mol |
| Exact Mass | 158.11 |
| IUPAC Name | 2-methylpropyl (NE)-N-(1-aminoethylidene)carbamate |
| SMILES | C/C(N)=N\C(=O)OCC(C)C |
| InChI | InChI=1S/C7H14N2O2/c1-5(2)4-11-7(10)9-6(3)8/h5H,4H2,1-3H3,(H2,8,9,10) |
| InChIKey | AEMQLVAWIHFWRK-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.20 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 2-methylpropyl (NE)-N-(1-aminoethylidene)carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylpropyl (NE)-N-(1-aminoethylidene)carbamate?
The IUPAC name of 2-methylpropyl (NE)-N-(1-aminoethylidene)carbamate (CID 20754855) is 2-methylpropyl (NE)-N-(1-aminoethylidene)carbamate.
What is the SMILES notation for 2-methylpropyl (NE)-N-(1-aminoethylidene)carbamate?
The canonical SMILES for 2-methylpropyl (NE)-N-(1-aminoethylidene)carbamate is C/C(N)=N\C(=O)OCC(C)C.
What is the InChIKey of 2-methylpropyl (NE)-N-(1-aminoethylidene)carbamate?
The InChIKey is AEMQLVAWIHFWRK-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14N2O2/c1-5(2)4-11-7(10)9-6(3)8/h5H,4H2,1-3H3,(H2,8,9,10).
What are the key properties of 2-methylpropyl (NE)-N-(1-aminoethylidene)carbamate?
2-methylpropyl (NE)-N-(1-aminoethylidene)carbamate has a molecular weight of 158.20 g/mol, XLogP of 1.16, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylpropyl (NE)-N-(1-aminoethylidene)carbamate is sourced from PubChem (CID 20754855), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).